01904 488599
Indole-3-Butyric Acid >= 99.0% (T)
From £633.86 per (ex VAT)
Indole-3-Butyric Acid >= 99.0% (T)
| Product Code | 57310-100G-F |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 133-32-4 |
| MDL NUMBER | MFCD00005664 |
| EMPIRICAL FORMULA | C12H13NO2 |
| Molecular Weight | 203.24 |
| Synonyms | 4-(3-Indolyl)Butanoic Acid; 4-(3-Indolyl)Butyric Acid; Iba |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 57310-100G-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £711.16 |
| 12+ | 10% | £695.70 |
| 36+ | 12% | £680.24 |
| 72+ | 18% | £633.86 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | C |
| CAS Number | 133-32-4 |
| ADR Hazard Labels | 6.1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 60 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| EINECSNo | 205-101-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 3,Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H301-H315-H319-H335 |
| GHS Hazard Statements | Toxic if swallowed. Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS06 |
| GHS Precaution Codes | P261 - P301 + P310 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00005664 |
| Melting Point | 122-125 C |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| Net Weight | 100 |
| R-Phrases | 25-36/37/38 |
| RTECSNo | NL5250000 |
| S-Phrases | 26-36-45 |
| Synonyms | 4-(3-Indolyl)butanoic acid; 4-(3-Indolyl)butyric acid; IBA |
| Tariff Number | 29339980900 |
| Technical Name | 3-INDOLEBUTYRIC ACID |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=57310brand=SIGMA |
| Assay | >=99.0% (T) |
| mp | 122-125 C |
| InChI | 1S/C12H13NO2/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11/h1-2,5-6,8,13H,3-4,7H2,(H,14,15) |
| Quality Level | 100 |
| SMILES string | OC(=O)CCCc1c[nH]c2ccccc12 |
| InChI key | JTEDVYBZBROSJT-UHFFFAOYSA-N |
Description
Indole-3-Butyric Acid >= 99.0% (T)