01904 488599
Tetraoctylammonium Nitrate
From £235.62 per (ex VAT)
Tetraoctylammonium Nitrate
| Product Code | 87983-500MG |
|---|---|
| Unit of Measure | 1X500MG |
| CAS Number | 33734-52-0 |
| MDL NUMBER | MFCD00525561 |
| EMPIRICAL FORMULA | C32H68N2O3 |
| Molecular Weight | 528.89 |
| Brand | SUPELCO |
Tiered Pricing - 87983-500MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £266.22 |
| 12+ | 15% | £260.10 |
| 36+ | 17% | £253.98 |
| 72+ | 23% | £235.62 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 26111700 |
| ADRSuff | 1 |
| CAS Number | 33734-52-0 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00525561 |
| Melting Point | 112-114 C |
| Molecular Formula | C32H68N2O3 |
| Molecular Weight | 528.89 |
| Net Weight | 500 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Tariff Number | 29239000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=87983brand=SIAL |
| mp | 112-114 C |
| Quality Level | 200 |
| Assay | >=99.0% |
| SMILES string | [O-][N+]([O-])=O.CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC |
| InChI | 1S/C32H68N.NO3/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;2-1(3)4/h5-32H2,1-4H3;/q+1;-1 |
| impurities | <=0.05% halides (as bromide) |
| product line | Selectophore(TM) |
| form | powder |
| grade | for ion-selective electrodes |
| InChI key | MJHKPBXGJMKYAY-UHFFFAOYSA-N |
Description
Tetraoctylammonium Nitrate