01904 488599
Pentaerythritol Tetranitrate (Petn)
From £2,620.00 per (ex VAT)
Pentaerythritol Tetranitrate (Petn)
| Product Code | ERP-109S-5ML |
|---|---|
| Unit of Measure | 1X5ML |
| CAS Number | 78-11-5 |
| MDL NUMBER | MFCD00058681 |
| EMPIRICAL FORMULA | C5H8N4O12 |
| Molecular Weight | 316.14 |
| Synonyms | Pentaerythritol Tetranitrate; Petn |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | A3 |
| CAS Number | 78-11-5 |
| ADR Hazard Labels | 3 |
| ADR Packing Group | 1 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Desensitized explosive, liquid, n.o.s. |
| ADRNo | 3379 |
| Storage Temperature | -20C |
| Flash Point | 2 C - closed cup |
| GHS Categories | Flam. Liq. 2,Acute Tox. 4,Eye Irrit. 2,Acute Tox. 4 |
| GHS Hazard Codes | H225-H302-H319-H332 |
| GHS Hazard Statements | Highly flammable liquid and vapour. Harmful if swallowed. Causes serious eye irritation. Harmful if inhaled. |
| GHS Pictograms | GHS02,GHS07 |
| GHS Precaution Codes | P210 - P305 + P351 + P338 |
| GHS Signal Words | Danger |
| MDL Number | MFCD00058681 |
| Molecular Formula | C5H8N4O12 |
| Molecular Weight | 316.14 |
| Net Weight | 9 |
| Synonyms | Pentaerythritol tetranitrate; PETN |
| Tariff Number | 38220000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=ERP-109Sbrand=CERILLIAN |
| Quality Level | 300 |
| feature | Snap-N-Spike(R)/Snap-N-Shoot(R) |
| InChI key | TZRXHJWUDPFEEY-UHFFFAOYSA-N |
| InChI | 1S/C5H8N4O12/c10-6(11)18-1-5(2-19-7(12)13,3-20-8(14)15)4-21-9(16)17/h1-4H2 |
| grade | certified reference material |
| storage temp. | -20C |
| packaging | ampule of 5 mL |
| concentration | 10 mg/mL in acetonitrile |
| Application(s) | environmental |
| SMILES string | O=[N+]([O-])OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O |
| format | single component solution |
| manufacturer/tradename | Cerilliant(R) |
Description
Pentaerythritol Tetranitrate (Petn)