01904 488599
D(-)-Arabinose, For Microbiology
From £117.92 per (ex VAT)
D(-)-Arabinose, For Microbiology
| Product Code | 10850-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 10323-20-3 |
| MDL NUMBER | MFCD00064361 |
| EMPIRICAL FORMULA | C5HO5 |
| Molecular Weight | 150.13 |
| Brand | MILLIPORE |
Tiered Pricing - 10850-100G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £123.28 |
| 12+ | 10% | £120.60 |
| 36+ | 12% | £117.92 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 10323-20-3 |
| EINECSNo | 233-708-5 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a hazardous substance or mixture according to Regulation (EC) No. 1272/2008. |
| GHS Signal Words | - |
| MDL Number | MFCD00064361 |
| Melting Point | 162-164 C (lit.) |
| Molecular Formula | C5HO5 |
| Molecular Weight | 150.13 |
| Net Weight | 100 |
| Tariff Number | 29400000800 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=10850brand=SIAL |
| cation traces | Na: <=50 mg/kg |
| Quality Level | 200 |
| loss | <=0.1% loss on drying, 20 C (HV) |
| Application(s) | microbiology |
| Assay | >=99.0% |
| Anion Traces | sulfate (SO42-): <=50 mg/kg |
| ign. residue | <=0.1% (as SO4) |
| optical activity | [alpha]20/D -104+/-2.0, 24 hr, c = 10% in H2O |
| InChI | 1S/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5?/m1/s1 |
| InChI key | SRBFZHDQGSBBOR-ZRMNMSDTSA-N |
| mp | 162-164 C (lit.) |
| SMILES string | O[C@@H]1COC(O)[C@@H](O)[C@@H]1O |
| form | powder |
Description
D(-)-Arabinose, For Microbiology