01904 488599
G-Glu-Cys Trifluoroacetate
From £500.08 per (ex VAT)
G-Glu-Cys Trifluoroacetate
| Product Code | G0903-100MG |
|---|---|
| Unit of Measure | 1X100MG |
| CAS Number | 636-58-8 |
| MDL NUMBER | MFCD00237863 |
| EMPIRICAL FORMULA | C8H14N2O5S |
| Molecular Weight | 250.27 |
| Synonyms | Gamma-L-Glutamyl-L-Cysteine; Des-Gly-Glutathione Reduced Form |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - G0903-100MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 5% | £505.40 |
| 12+ | 6% | £500.08 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 636-58-8 |
| Storage Temperature | -20C |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00237863 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.27 |
| Net Weight | 100 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | gamma-L-Glutamyl-L-cysteine; des-Gly-glutathione reduced form |
| Tariff Number | 29309098990 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=G0903brand=SIGMA |
| Composition | Peptide content, >=60% elemental analysis |
| Quality Level | 200 |
| SMILES string | N[C@@H](CCC(=O)N[C@@H](CS)C(O)=O)C(O)=O |
| technique(s) | ligand binding assay: suitable |
| InChI | 1S/C8H14N2O5S/c9-4(7(12)13)1-2-6(11)10-5(3-16)8(14)15/h4-5,16H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15)/t4-,5-/m0/s1 |
| form | powder |
| InChI key | RITKHVBHSGLULN-WHFBIAKZSA-N |
| Assay | >=80% (HPLC) |
| storage temp. | -20C |
| color | white to off-white |
Description
G-Glu-Cys Trifluoroacetate