01904 488599
L-Dihydroorotic Acid
From £221.84 per (ex VAT)
L-Dihydroorotic Acid
| Product Code | D7128-1G |
|---|---|
| Unit of Measure | 1X1GR |
| CAS Number | 5988-19-2 |
| MDL NUMBER | MFCD00085339 |
| EMPIRICAL FORMULA | C5H6N2O4 |
| Molecular Weight | 158.11 |
| Synonyms | 2,6-Dioxohexahydro-4-Pyrimidinecarboxylic Acid; L-Hydroorotic Acid; Dihydro-L-Orotic Acid |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - D7128-1G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 5% | £224.20 |
| 12+ | 6% | £221.84 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352204 |
| ADRSuff | 1 |
| CAS Number | 5988-19-2 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00085339 |
| Melting Point | 254-255 C (dec.) (lit.) |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 |
| Net Weight | 1 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | 2,6-Dioxohexahydro-4-pyrimidinecarboxylic acid; L-Hydroorotic acid; Dihydro-L-orotic acid |
| Tariff Number | 29335995900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=D7128brand=SIGMA |
| Quality Level | 200 |
| mp | 254-255 C (dec.) (lit.) |
| InChI | 1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/t2-/m0/s1 |
| InChI key | UFIVEPVSAGBUSI-REOHCLBHSA-N |
| form | powder |
| SMILES string | OC(=O)[C@@H]1CC(=O)NC(=O)N1 |
| Assay | >=99% |
Description
L-Dihydroorotic Acid