01904 488599
Ethidium Bromide
From £37.83 per (ex VAT)
Ethidium Bromide
| Product Code | E8751-1G |
|---|---|
| Unit of Measure | 1X1G |
| CAS Number | 1239-45-8 |
| MDL NUMBER | MFCD00011724 |
| EMPIRICAL FORMULA | C21H2BrN3 |
| Molecular Weight | 394.31 |
| Synonyms | 3,8-Diamino-5-Ethyl-6-Phenylphenanthridinium Bromide; Etbr; Homidium Bromide |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - E8751-1G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £39.77 |
| 12+ | 20% | £38.80 |
| 36+ | 22% | £37.83 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | A |
| CAS Number | 1239-45-8 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 66 |
| ADR Packing Group | 1 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| EINECSNo | 214-984-6 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Acute Tox. 2,Muta. 2 |
| GHS Hazard Codes | H302-H330-H341 |
| GHS Hazard Statements | Harmful if swallowed. Fatal if inhaled. Suspected of causing genetic defects. |
| GHS Pictograms | GHS06,GHS08 |
| GHS Precaution Codes | P260 - P281 - P284 - P310 |
| GHS Precaution Statements | Do not breathe dust/ fume/ gas/ mist/ vapours/ spray. Use personal protective equipment as required. Wear respiratory protection. Immediately call a POISON CENTER or doctor/ physician. |
| GHS Signal Words | Danger |
| Hazard Symbols | T+ |
| Hazard Symbols Descriptions | Very toxic |
| MDL Number | MFCD00011724 |
| Melting Point | 260-262 C (dec.) (lit.) |
| Molecular Formula | C21H2BrN3 |
| Molecular Weight | 394.31 |
| Net Weight | 1 |
| R-Phrases | 22-26-68 |
| RTECSNo | SF7950000 |
| S-Phrases | 28-36/37-45-63 |
| Synonyms | 3,8-Diamino-5-ethyl-6-phenylphenanthridinium bromide; EtBr; Homidium bromide |
| Tariff Number | 29339980900 |
| Technical Name | ETHIDIUM BROMIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=E8751brand=SIAL |
| SMILES string | [Br-].CC[n+]1c(-c2ccccc2)c3cc(N)ccc3c4ccc(N)cc14 |
| Quality Level | 200 |
| InChI key | ZMMJGEGLRURXTF-UHFFFAOYSA-N |
| InChI | 1S/C21H19N3.BrH/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,23H,2,22H2,1H3;1H |
| mp | 260-262 C (dec.) (lit.) |
| Assay | ~95% (HPLC) |
Description
Ethidium Bromide