01904 488599
Bis(2-Ethylhexyl) Sulfosuccinate Sodium
From £40.04 per (ex VAT)
Bis(2-Ethylhexyl) Sulfosuccinate Sodium
| Product Code | 86140-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 577-11-7 |
| MDL NUMBER | MFCD00012455 |
| EMPIRICAL FORMULA | C2H37NaO7S |
| Molecular Weight | 444.56 |
| Synonyms | Aot; Bis(2-Ethylhexyl) Sulfosuccinate Sodium Salt; Sodium Bis(2-Ethylhexyl) Sulfosuccinate; Sulfobutanedioic Acid Bis(2-Ethylhexyl Ester) Sodium Salt; Sulfosuccinic Acid Bis(2-Ethylhexyl) Ester Sodium Salt; 'Dioctyl' Sulfosuccinate Sodium Salt |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 86140-100G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £41.86 |
| 12+ | 10% | £40.95 |
| 36+ | 12% | £40.04 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 577-11-7 |
| EINECSNo | 209-406-4 |
| GHS Categories | Skin Irrit. 2,Eye Dam. 1 |
| GHS Hazard Codes | H315-H318 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye damage. |
| GHS Pictograms | GHS05 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 |
| GHS Precaution Statements | Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00012455 |
| Molecular Formula | C2H37NaO7S |
| Molecular Weight | 444.56 |
| Net Weight | 100 |
| R-Phrases | 38-41 |
| S-Phrases | 26-39 |
| Synonyms | AOT; Bis(2-ethylhexyl) sulfosuccinate sodium salt; Sodium bis(2-ethylhexyl) sulfosuccinate; Sulfobutanedioic acid bis(2-ethylhexyl ester) sodium salt; Sulfosuccinic acid bis(2-ethylhexyl) ester sodium salt; 'Dioctyl' sulfosuccinate sodium salt |
| Tariff Number | 29171980900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=86140brand=SIAL |
| Quality Level | 200 |
| InChI | 1S/C20H38O7S.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);/q;+1/p-1 |
| Assay | >=96.0% (TLC) |
| form | solid |
| impurities | <=2% water |
| InChI key | APSBXTVYXVQYAB-UHFFFAOYSA-M |
| grade | purum |
| SMILES string | [Na+].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S([O-])(=O)=O |
Description
Bis(2-Ethylhexyl) Sulfosuccinate Sodium