01904 488599
Tetraethylammonium Tetrafluoroborate,
From £79.64 per (ex VAT)
Tetraethylammonium Tetrafluoroborate,
| Product Code | 86618-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 429-06-1 |
| MDL NUMBER | MFCD00011827 |
| EMPIRICAL FORMULA | C8H2BF4N |
| Molecular Weight | 217.06 |
| Brand | SUPELCO |
Tiered Pricing - 86618-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £83.26 |
| 12+ | 10% | £81.45 |
| 36+ | 12% | £79.64 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 26111700 |
| ADRSuff | 1 |
| CAS Number | 429-06-1 |
| EINECSNo | 207-055-1 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Acute Tox. 4,Skin Irrit. 2,Eye Irrit. 2,Acute Tox. 4,STOT SE 3 |
| GHS Hazard Codes | H302-H312-H315-H319-H332-H335 |
| GHS Hazard Statements | Harmful if swallowed. Harmful in contact with skin. Causes skin irritation. Causes serious eye irritation. Harmful if inhaled. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P280 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ protective clothing. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00011827 |
| Melting Point | >=300 C (lit.) |
| Molecular Formula | C8H2BF4N |
| Molecular Weight | 217.06 |
| Net Weight | 5 |
| R-Phrases | 20/21/22-36/37/38 |
| S-Phrases | 26-36 |
| Tariff Number | 29239000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=86618brand=SIAL |
| Assay | >=99.0% (T) |
| form | crystals |
| InChI key | XJRAKUDXACGCHA-UHFFFAOYSA-N |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| Quality Level | 100 |
| InChI | 1S/C8H20N.BF4/c1-5-9(6-2,7-3)8-4;2-1(3,4)5/h5-8H2,1-4H3;/q+1;-1 |
| grade | for electrochemical analysis |
| SMILES string | F[B-](F)(F)F.CC[N+](CC)(CC)CC |
| mp | >=300 C (lit.) |
Description
Tetraethylammonium Tetrafluoroborate,