01904 488599
1-Hexanesulfonic Acid Sodium Salt, Mono
From £490.16 per (ex VAT)
1-Hexanesulfonic Acid Sodium Salt, Mono
| Product Code | 52862-50G-F |
|---|---|
| Unit of Measure | 1X50GR |
| CAS Number | 207300-91-2 |
| MDL NUMBER | MFCD00149549 |
| EMPIRICAL FORMULA | C6H13NaO3S |
| Molecular Weight | 206.24 |
| Synonyms | 1-Hexanesulfonic Acid Sodium Salt Monohydrate |
| Brand | SUPELCO |
Tiered Pricing - 52862-50G-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £512.44 |
| 12+ | 10% | £501.30 |
| 36+ | 12% | £490.16 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | 1 |
| CAS Number | 207300-91-2 |
| EINECSNo | 220-601-3 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a dangerous substance according to GHS. |
| GHS Signal Words | - |
| MDL Number | MFCD00149549 |
| Molecular Formula | C6H13NaO3S |
| Molecular Weight | 206.24 |
| Net Weight | 50 |
| Synonyms | 1-Hexanesulfonic acid sodium salt monohydrate |
| Tariff Number | 29041000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=52862brand=SIAL |
| Assay | >=99.0% (T) |
| UV absorption | lambda: 500 nm Amax: 0.02 |
| quality | LiChropur(TM) |
| lambda | 10 % in H2O |
| mol wt | 206.24 g/mol |
| SMILES string | O.[Na+].CCCCCCS([O-])(=O)=O |
| suitability | corresponds to standard for RP gradient test |
| InChI | 1S/C6H14O3S.Na.H2O/c1-2-3-4-5-6-10(7,8)9;;/h2-6H2,1H3,(H,7,8,9);;1H2/q;+1;/p-1 |
| Quality Level | 100 |
| InChI key | CLCGFJYKZGFGSQ-UHFFFAOYSA-M |
| form | solid |
| description | anionic |
| technique(s) | HPLC: suitable |
Description
1-Hexanesulfonic Acid Sodium Salt, Mono