1,1′-DIETHYL-4,4′-CYANINE IODIDE
From £42.42 per (ex VAT)
1,1′-Diethyl-4,4′-cyanine iodide
| Product Code | 291331-100MG |
|---|---|
| MDL NUMBER | MFCD00151338 |
| EMPIRICAL FORMULA | C23H23IN2 |
| Molecular Weight | 454.35 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 291331-100MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £49.69 |
| 12+ | 20% | £48.48 |
| 36+ | 22% | £47.27 |
| 72+ | 30% | £42.42 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | C |
| CAS Number | 4727-49-5 |
| ADR Hazard Labels | 6.1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 60 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| Storage Temperature | room temp |
| EINECSNo | 225-223-2 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 3,Acute Tox. 3,Skin Irrit. 2,Eye Irrit. 2,Acute Tox. 3,STOT SE 3 |
| GHS Hazard Codes | H301-H311-H315-H319-H331-H335 |
| GHS Hazard Statements | Toxic if swallowed. Toxic in contact with skin. Causes skin irritation. Causes serious eye irritation. Toxic if inhaled. May cause respiratory irritation. |
| GHS Pictograms | GHS06 |
| GHS Precaution Codes | P261 - P280 - P301 + P310 - P305 + P351 + P338 - P311 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ protective clothing. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00151338 |
| Melting Point | 280 C (dec.) (lit.) |
| Molecular Formula | C23H23IN2 |
| Molecular Weight | 454.35 |
| Net Weight | 100 |
| R-Phrases | 23/24/25-36/37/38 |
| S-Phrases | 26-36/37/39-45 |
| Tariff Number | 29334990900 |
| Technical Name | 1,1'-DIETHYL-4,4'-CYANINE IODIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=291331brand=ALDRICH |
| SMILES string | [I-].CCN1C=CC(=Cc2cc[n+](CC)c3ccccc23)c4ccccc14 |
| epsilon (extinction coefficient) | >=75000 at 588-596 nm in ethanol at 0.003 g/L |
| form | powder or crystals |
| storage temp. | room temp |
| InChI | 1S/C23H23N2.HI/c1-3-24-15-13-18(20-9-5-7-11-22(20)24)17-19-14-16-25(4-2)23-12-8-6-10-21(19)23;/h5-17H,3-4H2,1-2H3;1H/q+1;/p-1 |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| InChI key | BFVPXROCOCTNOP-UHFFFAOYSA-M |
| Quality Level | 100 |
| mp | 280 C (dec.) (lit.) |
Description
1,1'-Diethyl-4,4'-cyanine iodide