01904 488599
2-Ketobutyric Acid-4-13C, Sodium Salt H
From £376.98 per (ex VAT)
2-Ketobutyric Acid-4-13C, Sodium Salt H
| Product Code | 571342-250MG |
|---|---|
| Unit of Measure | 1X250MG |
| CAS Number | 634908-43-3 |
| MDL NUMBER | MFCD04118128 |
| EMPIRICAL FORMULA | C4H5NaO3 |
| Molecular Weight | 125.06 (anhydrous basis) |
| Synonyms | Alpha-Keto-Butyric Acid-4-13C Sodium; Alpha-Ketobutyric Acid-4-13C Sodium Salt; 2-Oxobutanoic Acid-4-13C Sodium Salt; Sodium Alpha-Ketobutyrate-4-13C |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 634908-43-3 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD04118128 |
| Melting Point | 210 C (dec.) (lit.) |
| Molecular Formula | C4H5NaO3 |
| Net Weight | 250 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | alpha-Keto-butyric acid-4-13C sodium; alpha-Ketobutyric acid-4-13C sodium salt; 2-Oxobutanoic acid-4-13C sodium salt; Sodium alpha-ketobutyrate-4-13C |
| Tariff Number | 28459090900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=571342brand=ALDRICH |
| Quality Level | 200 |
| mass shift | M+1 |
| SMILES string | O.[Na+].[13CH3]CC(=O)C([O-])=O |
| isotopic purity | 99 atom % 13C |
| technique(s) | bio NMR: suitable |
| InChI | 1S/C4H6O3.Na.H2O/c1-2-3(5)4(6)7;;/h2H2,1H3,(H,6,7);;1H2/q;+1;/p-1/i1+1;; |
| Assay | 97% (CP) |
| form | solid |
| InChI key | PVLJVKQSCAHPPR-GOCMCNPZSA-M |
| mp | 210 C (dec.) (lit.) |
Description
2-Ketobutyric Acid-4-13C, Sodium Salt H