01904 488599
2,6,6-TRIMETHYL-1-CYCLOHEXENE-1-ACET
£640.00 Each (ex VAT)
2,6,6-Trimethyl-1-cyclohexene-1-acetaldehyde, >=75%
| Product Code | W347418-100G |
|---|---|
| Unit of Measure | 1X100G |
| CAS Number | 404 |
| MDL NUMBER | MFCD00012057 |
| EMPIRICAL FORMULA | C11H18O |
| Molecular Weight | 166.26 |
| Synonyms | beta-Homocyclocitral |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12164502 |
| ADRSuff | 1 |
| CAS Number | 472-66-2 |
| Boiling Point | 58-59 C/0.4 mmHg (lit.) |
| Storage Temperature | 2-8C |
| Density | 0.941 g/mL at 25 C (lit.) |
| EINECSNo | 207-454-0 |
| Flash Point | 88 C - closed cup |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00012057 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| Net Weight | 100 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | beta-Homocyclocitral |
| Tariff Number | 29122900900 |
| Application(s) | flavors and fragrances |
| Quality Level | 400 |
| food allergen | no known allergens |
| biological source | synthetic |
| reg. compliance | EU Regulation 1223/2009 |
| refractive index | n20/D 1.485 (lit.) |
| SMILES string | [H]C(=O)CC1=C(C)CCCC1(C)C |
| storage temp. | 2-8C |
| InChI key | VHTFHZGAMYUZEP-UHFFFAOYSA-N |
| grade | Halal |
| fragrance allergen | no known allergens |
| Documentation | see Safety & Documentation for available documents |
| Organoleptic | oily; fruity; cooling; camphoraceous; woody |
| agency | follows IFRA guidelines |
| InChI | 1S/C11H18O/c1-9-5-4-7-11(2,3)10(9)6-8-12/h8H,4-7H2,1-3H3 |
| Assay | >=75% |
| impurities | <=20% beta-cyclocitral |
| bp | 58-59 C/0.4 mmHg (lit.) |
Description
2,6,6-Trimethyl-1-cyclohexene-1-acetaldehyde, >=75%