2′,7′-BIS(2-CARBOXYETHYL)-5(6)-CARBOXY
From £132.30 per (ex VAT)
2′,7′-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein acetoxymethyl ester, 1 mg/mL in DMSO
| Product Code | B8806-1MG |
|---|---|
| Synonyms | BCECF-AM solution; Spiro(isobenzofuran-1(3H),9'-(9H)xanthene)-2',7'-dipropanoic acid |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - B8806-1MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £154.98 |
| 12+ | 20% | £151.20 |
| 36+ | 22% | £147.42 |
| 72+ | 30% | £132.30 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | WICE |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| Storage Temperature | -20C |
| EINECSNo | 200-664-3 |
| Flash Point | 85 C |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Signal Words | - |
| Net Weight | 1 |
| Synonyms | BCECF-AM solution; Spiro(isobenzofuran-1(3H),9'-(9H)xanthene)-2',7'-dipropanoic acid |
| Tariff Number | 38249992990 |
| SMILES string | CC(=O)OCOC(=O)CCc1cc2c(Oc3cc(OCOC(C)=O)c(CCC(=O)OCOC(C)=O)cc3C24OC(=O)c5cc(ccc45)C(=O)OCOC(C)=O)cc1OCOC(C)=O |
| Quality Level | 200 |
| description | Mixture of six isomeric compounds |
| concentration | 1 mg/mL in DMSO |
| color | colorless to yellow |
| form | liquid |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| storage temp. | -20C |
Description
2',7'-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein acetoxymethyl ester, 1 mg/mL in DMSO