01904 488599
Acetaldehyde 2,4-Dinitrophenylhydrazone
From £229.08 per (ex VAT)
Acetaldehyde 2,4-Dinitrophenylhydrazone
| Product Code | 429554-20MG |
|---|---|
| Unit of Measure | 1X20MG |
| CAS Number | 1019-57-4 |
| MDL NUMBER | MFCD00458721 |
| EMPIRICAL FORMULA | C8H8N4O4 |
| Molecular Weight | 224.17 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 429554-20MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £240.12 |
| 12+ | 15% | £234.60 |
| 36+ | 17% | £229.08 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 1019-57-4 |
| Storage Temperature | room temp |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Skin Irrit. 2,Skin Sens. 1,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H302-H315-H317-H319-H335 |
| GHS Hazard Statements | Harmful if swallowed. Causes skin irritation. May cause an allergic skin reaction. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P280 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00458721 |
| Melting Point | 165-168 C (lit.) |
| Molecular Formula | C8H8N4O4 |
| Molecular Weight | 224.17 |
| Net Weight | 20 |
| R-Phrases | 22-36/37/38-43 |
| S-Phrases | 26-36/37 |
| Tariff Number | 29280090900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=429554brand=SIAL |
| Quality Level | 200 |
| form | powder or crystals |
| Assay | 99% |
| storage temp. | room temp |
| SMILES string | CC=NNc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| Application(s) | diagnostic assay manufacturingenvironmentalhematologyhistology |
| InChI key | ONBOQRNOMHHDFB-XNWCZRBMSA-N |
| grade | analytical standard, for environmental analysis |
| mp | 165-168 C (lit.) |
| InChI | 1S/C8H8N4O4/c1-2-9-10-7-4-3-6(11(13)14)5-8(7)12(15)16/h2-5,10H,1H3/b9-2+ |
Description
Acetaldehyde 2,4-Dinitrophenylhydrazone