01904 488599
Cyclohexane-D12, >=99.6 Atom % D
From £141.68 per (ex VAT)
Cyclohexane-D12, >=99.6 Atom % D
| Product Code | 151866-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 1735-17-7 |
| MDL NUMBER | MFCD00044212 |
| EMPIRICAL FORMULA | C6H12 |
| Molecular Weight | 96.23 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 151866-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £148.12 |
| 12+ | 10% | £144.90 |
| 36+ | 12% | £141.68 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12142201 |
| ADRSuff | 1 |
| CAS Number | 1735-17-7 |
| ADR Hazard Labels | 3 |
| ADR Number of Danger | 33 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Cyclohexane |
| ADRNo | 1145 |
| Boiling Point | 80.7 C (lit.) |
| Density | 0.893 g/mL at 25 C (lit.) |
| Dual Use Material | X |
| EINECSNo | 217-077-3 |
| Flash Point | -18 C - closed cup |
| GHS Categories | Flam. Liq. 2,Asp. Tox. 1,Skin Irrit. 2,STOT SE 3,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H225-H304-H315-H336-H400-H410 |
| GHS Hazard Statements | Highly flammable liquid and vapour. May be fatal if swallowed and enters airways. Causes skin irritation. May cause drowsiness or dizziness. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS02,GHS08,GHS07,GHS09 |
| GHS Precaution Codes | P210 - P261 - P273 - P301 + P310 - P331 - P501 |
| GHS Signal Words | Danger |
| Hazard Symbols | F,Xn,N |
| Hazard Symbols Descriptions | Highly flammable, Harmful, Dangerous for the environment |
| MDL Number | MFCD00044212 |
| Melting Point | 6.5 C (lit.) |
| Molecular Formula | C6H12 |
| Molecular Weight | 96.23 |
| Net Weight | 5 |
| R-Phrases | 11-38-50/53-65-67 |
| GHS Precaution Statements | Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Avoid release to the environment. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. Do NOT induce vomiting. Dispos |
| S-Phrases | 9-16-25-33-60-61-62 |
| Tariff Number | 28459010000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=151866brand=ALDRICH |
| bp | 80.7 C (lit.) |
| Assay | >=99% (CP) |
| Quality Level | 200 |
| SMILES string | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] |
| form | liquid |
| mass shift | M+12 |
| isotopic purity | >=99.6 atom % D |
| InChI key | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| mp | 6.5 C (lit.) |
| expl. lim. | 0.34-6.3 % (lit.) |
| InChI | 1S/C6H12/c1-2-4-6-5-3-1/h1-6H2/i1D2,2D2,3D2,4D2,5D2,6D2 |
| technique(s) | NMR: suitable |
| refractive index | n20/D 1.421 (lit.) |
Description
Cyclohexane-D12, >=99.6 Atom % D