01904 488599
Dimethyl Sulfoxide-D6, “100%”, 99.96 At
From £380.16 per (ex VAT)
Dimethyl Sulfoxide-D6, “100%”, 99.96 At
| Product Code | 156914-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 2206-27-1 |
| MDL NUMBER | MFCD00002090 |
| EMPIRICAL FORMULA | C2H6OS |
| Molecular Weight | 84.17 |
| Synonyms | (Methyl Sulfoxide)-D6; Dmso-D6; Hexadeuterodimethyl Sulfoxide |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 156914-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £397.44 |
| 12+ | 10% | £388.80 |
| 36+ | 12% | £380.16 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12191502 |
| ADRSuff | 1 |
| CAS Number | 2206-27-1 |
| Boiling Point | 189 C (lit.) |
| Density | 1.190 g/mL at 25 C (lit.) |
| Dual Use Material | X |
| EINECSNo | 218-617-0 |
| Flash Point | 88 C |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a hazardous substance or mixture according to Regulation (EC) No. 1272/2008. |
| GHS Signal Words | - |
| MDL Number | MFCD00002090 |
| Melting Point | 20.2 C (lit.) |
| Molecular Formula | C2H6OS |
| Molecular Weight | 84.17 |
| Net Weight | 25 |
| Synonyms | (Methyl sulfoxide)-d6; DMSO-d6; Hexadeuterodimethyl sulfoxide |
| Tariff Number | 28459010000 |
| Technical Name | methyl sulfoxide |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=156914brand=ALDRICH |
| Assay | >=99% (CP) |
| mass shift | M+6 |
| bp | 189 C (lit.) |
| form | liquid |
| InChI | 1S/C2H6OS/c1-4(2)3/h1-2H3/i1D3,2D3 |
| Quality Level | 100 |
| refractive index | n20/D 1.476 (lit.) |
| impurities | <=0.0250% waterwater |
| expl. lim. | 42 % |
| technique(s) | NMR: suitable |
| SMILES string | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| autoignition temp. | 573 F |
| InChI key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| isotopic purity | 99.96 atom % D |
| mp | 20.2 C (lit.) |
| vapor pressure | 0.42 mmHg ( 20 C) |
Description
Dimethyl Sulfoxide-D6, "100%", 99.96 At