01904 488599
Diphenylphosphinic Chloride, 98%
From £172.48 per (ex VAT)
Diphenylphosphinic Chloride, 98%
| Product Code | 230235-50G |
|---|---|
| Unit of Measure | 1X50GR |
| CAS Number | 1499-21-4 |
| MDL NUMBER | MFCD00002077 |
| EMPIRICAL FORMULA | C12HClOP |
| Molecular Weight | 236.63 |
| Synonyms | Diphenylchlorophosphine Oxide; Diphenylphosphinic Acid Chloride; Diphenylphosphinoyl Chloride; Diphenylphosphinyl Chloride; Diphenylphosphorus Oxychloride; Ph2Pocl; Chlorodiphenylphosphine Oxide |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 230235-50G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £180.32 |
| 12+ | 10% | £176.40 |
| 36+ | 12% | £172.48 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | BA |
| CAS Number | 1499-21-4 |
| ADR Hazard Labels | 8 |
| ADR Number of Danger | 83 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 8 |
| ADR Proper Shipping Name | Corrosive liquid, flammable, n.o.s. |
| ADR SubHaz Classes | 3 |
| ADRNo | 2920 |
| Boiling Point | 222 C/16 mmHg (lit.) |
| Storage Temperature | 2-8C |
| Density | 1.24 g/mL at 25 C (lit.) |
| EINECSNo | 216-107-2 |
| Flash Point | 26 C - closed cup |
| GHS Categories | Flam. Liq. 3,Skin Corr. 1B |
| GHS Hazard Codes | H226-H314 |
| GHS Hazard Statements | Flammable liquid and vapour. Causes severe skin burns and eye damage. |
| GHS Pictograms | GHS02,GHS05 |
| GHS Precaution Codes | P210 - P260 - P280 - P303 + P361 + P353 - P305 + P351 + P338 - P370 + P378 |
| GHS Precaution Statements | Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/ phys |
| GHS Signal Words | Danger |
| Hazard Symbols | C |
| Hazard Symbols Descriptions | Corrosive |
| MDL Number | MFCD00002077 |
| Molecular Formula | C12HClOP |
| Molecular Weight | 236.63 |
| Net Weight | 50 |
| Purity Grade | 0.98 |
| R-Phrases | Oct-34 |
| S-Phrases | 16-26-36/37/39-45 |
| Synonyms | Diphenylchlorophosphine oxide; Diphenylphosphinic acid chloride; Diphenylphosphinoyl chloride; Diphenylphosphinyl chloride; Diphenylphosphorus oxychloride; Ph2POCl; Chlorodiphenylphosphine oxide |
| Tariff Number | 29313990900 |
| Technical Name | DIPHENYLPHOSPHINIC CHLORIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=230235brand=ALDRICH |
| InChI key | QPQGTZMAQRXCJW-UHFFFAOYSA-N |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| form | liquid |
| bp | 222 C/16 mmHg (lit.) |
| InChI | 1S/C12H10ClOP/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| Quality Level | 100 |
| storage temp. | 2-8C |
| functional group | phosphine |
| refractive index | n20/D 1.609 (lit.) |
| Assay | 98% |
| SMILES string | ClP(=O)(c1ccccc1)c2ccccc2 |
Description
Diphenylphosphinic Chloride, 98%