01904 488599
Erythrosin B Certified Sodium
From £83.83 per (ex VAT)
Erythrosin B Certified Sodium
| Product Code | E8886-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 16423-68-0 |
| MDL NUMBER | MFCD00144257 |
| EMPIRICAL FORMULA | C2H6I4Na2O5 |
| Molecular Weight | 879.86 |
| Synonyms | 2',4',5',7'-Tetraiodofluorescein Disodium Salt; Acid Red 51; Iodoeosin |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - E8886-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £87.87 |
| 12+ | 15% | £85.85 |
| 36+ | 17% | £83.83 |
Properties
| Property | Value |
|---|---|
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=E8886brand=SIGMA |
| pH | 6.4 (30.3 C) |
| InChI key | RAGZEDHHTPQLAI-UHFFFAOYSA-L |
| grade | certified by the Biological Stain Commission |
| InChI | 1S/C20H8I4O5.2Na/c21-11-5-9-17(13(23)15(11)25)28-18-10(6-12(22)16(26)14(18)24)20(9)8-4-2-1-3-7(8)19(27)29-20;;/h1-6,25-26H;;/q;2*+1/p-2 |
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 16423-68-0 |
| Storage Temperature | room temp |
| Density | 0.625-0.731 g/cm3 at 30.1 C |
| EINECSNo | 240-474-8 |
| Flash Point | 182 C - closed cup |
| GHS Categories | Acute Tox. 4,Aquatic Chronic 4 |
| GHS Hazard Codes | H302-H413 |
| GHS Hazard Statements | Harmful if swallowed. May cause long lasting harmful effects to aquatic life. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P301 + P312 + P330 |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00144257 |
| Melting Point | 315 C |
| Molecular Formula | C2H6I4Na2O5 |
| Molecular Weight | 879.86 |
| Net Weight | 25 |
| R-Phrases | 22 |
| S-Phrases | 36 |
| Synonyms | 2',4',5',7'-Tetraiodofluorescein disodium salt; Acid Red 51; Iodoeosin |
| Composition | Dye content, >=80% |
| SMILES string | [Na+].[Na+].[O-]c1c(I)cc2c(Oc3c(I)c([O-])c(I)cc3C24OC(=O)c5ccccc45)c1I |
| solubility | water: 1 mg/mL, clear |
| storage temp. | room temp |
| form | powder |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| mp | 315 C |
| Quality Level | 200 |
Description
Erythrosin B Certified Sodium