01904 488599
HEPTAFLUOROBUTYRIC ANHYDRIDE,
From £130.24 per (ex VAT)
Heptafluorobutyric anhydride, for GC derivatization, LiChropur(TM), >=99.0%
| Product Code | 394912-5ML |
|---|---|
| Unit of Measure | 1X5ML |
| CAS Number | 336-59-4 |
| MDL NUMBER | MFCD00000432 |
| EMPIRICAL FORMULA | C8HF14O3 |
| Molecular Weight | 410.06 |
| Synonyms | HFBA; HFAA; HFBA; Perfluorobutyric anhydride |
| Brand | SUPELCO |
Tiered Pricing - 394912-5ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £136.16 |
| 12+ | 10% | £133.20 |
| 36+ | 12% | £130.24 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12000000 |
| ADRSuff | B |
| CAS Number | 336-59-4 |
| ADR Hazard Labels | 8 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 80 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 8 |
| ADR Proper Shipping Name | Corrosive liquid, acidic, organic, n.o.s. |
| ADRNo | 3265 |
| Boiling Point | 108-110 C (lit.) |
| Density | 1.674 g/mL at 20 C (lit.) |
| EINECSNo | 206-410-8 |
| Flash Point | Not applicable |
| GHS Categories | Skin Corr. 1B |
| GHS Hazard Codes | H314 |
| GHS Hazard Statements | Causes severe skin burns and eye damage. |
| GHS Pictograms | GHS05 |
| GHS Precaution Codes | P280 - P305 + P351 + P338 - P310 |
| GHS Precaution Statements | Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/ phys |
| GHS Signal Words | Danger |
| Hazard Symbols | C |
| Hazard Symbols Descriptions | Corrosive |
| MDL Number | MFCD00000432 |
| Melting Point | -43 C (lit.) |
| Molecular Formula | C8HF14O3 |
| Molecular Weight | 410.06 |
| Net Weight | 8.325 |
| R-Phrases | 34 |
| S-Phrases | 26-36/37/39-45 |
| Synonyms | HFBA; HFAA; HFBA; Perfluorobutyric anhydride |
| Tariff Number | 29159070900 |
| Technical Name | HEPTAFLUOROBUTYRIC ANHYDRIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=394912brand=ALDRICH |
| mp | -43 C (lit.) |
| reaction suitability | reagent type: derivatization reagentreaction type: Acylations |
| quality | LiChropur(TM) |
| Assay | >=99.0% |
| form | liquid |
| technique(s) | gas chromatography (GC): suitable |
| grade | for GC derivatization |
| bp | 108-110 C (lit.) |
| InChI | 1S/C8F14O3/c9-3(10,5(13,14)7(17,18)19)1(23)25-2(24)4(11,12)6(15,16)8(20,21)22 |
| Quality Level | 100 |
| refractive index | n20/D 1.287 (lit.) |
| SMILES string | FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI key | UFFSXJKVKBQEHC-UHFFFAOYSA-N |
Description
Heptafluorobutyric anhydride, for GC derivatization, LiChropur(TM), >=99.0%