01904 488599
Inosine 5′-Monophosphate Disodium Salt
From £42.50 per (ex VAT)
Inosine 5′-Monophosphate Disodium Salt
| Product Code | I4625-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 352195-40-5 |
| MDL NUMBER | MFCD00150372 |
| EMPIRICAL FORMULA | CH11N4Na2O8P |
| Molecular Weight | 392.17 (anhydrous basis) |
| Synonyms | 5'-Imp-Na2; 5'-Inosinic Acid Disodium Salt Hydrate; I-5'-P; Imp; Inosinic Acid |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41106305 |
| ADRSuff | 1 |
| CAS Number | 352195-40-5 |
| Storage Temperature | 2-8C |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a dangerous substance according to GHS. |
| GHS Signal Words | - |
| MDL Number | MFCD00150372 |
| Molecular Formula | CH11N4Na2O8P |
| Net Weight | 5 |
| Synonyms | 5'-IMP-Na2; 5'-Inosinic acid disodium salt hydrate; I-5'-P; IMP; Inosinic Acid |
| Tariff Number | 29349990900 |
| solubility | water: 50 mg/mL, clear, colorless |
| Quality Level | 200 |
| storage temp. | 2-8C |
| type | Grade III |
| biological source | yeast |
| SMILES string | [Na+].[Na+].O[C@H]1[C@@H](O)[C@@H](O[C@@H]1COP([O-])([O-])=O)n2cnc3C(=O)NC=Nc23 |
| form | powder |
| Assay | >=98% (HPLC) |
Description
Inosine 5'-Monophosphate Disodium Salt