01904 488599
N,N-Dimethylformamide-D7, >=99.5 Ato
From £440.88 per (ex VAT)
N,N-Dimethylformamide-D7, >=99.5 Ato
| Product Code | 189979-10G |
|---|---|
| Unit of Measure | 1X10GR |
| CAS Number | 4472-41-7 |
| MDL NUMBER | MFCD00003286 |
| EMPIRICAL FORMULA | C3H7NO |
| Molecular Weight | 80.14 |
| Synonyms | Dmf-D7; Heptadeutero-N,N-Dimethylformamide |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 189979-10G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £460.92 |
| 12+ | 10% | £450.90 |
| 36+ | 12% | £440.88 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12142201 |
| ADRSuff | 1 |
| CAS Number | 4472-41-7 |
| ADR Hazard Labels | 3 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 30 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | N,N-Dimethylformamide |
| ADRNo | 2265 |
| Boiling Point | 153 C (lit.) |
| Density | 1.03 g/mL at 25 C (lit.) |
| Dual Use Material | X |
| Flash Point | 58 C |
| GHS Categories | Flam. Liq. 3,Acute Tox. 4,Eye Irrit. 2,Acute Tox. 4,Repr. 1B |
| GHS Hazard Codes | H226-H312-H319-H332-H360 |
| GHS Hazard Statements | Flammable liquid and vapour. Harmful in contact with skin. Causes serious eye irritation. Harmful if inhaled. May damage fertility or the unborn child. |
| GHS Pictograms | GHS02,GHS08,GHS07 |
| GHS Precaution Codes | P201 - P280 - P305 + P351 + P338 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. Wear protective gloves/ protective clothing. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. IF exposed or concerned: Get medical advi |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00003286 |
| Molecular Formula | C3H7NO |
| Molecular Weight | 80.14 |
| Net Weight | 10 |
| R-Phrases | 61-20/21-36 |
| S-Phrases | 53-45 |
| Synonyms | DMF-d7; Heptadeutero-N,N-dimethylformamide |
| Tariff Number | 28459010000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=189979brand=ALDRICH |
| Assay | >=99% (CP) |
| SMILES string | [2H]C(=O)N(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Quality Level | 200 |
| bp | 153 C (lit.) |
| mass shift | M+7 |
| form | liquid |
| InChI | 1S/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3,3D |
| technique(s) | NMR: suitable |
| isotopic purity | >=99.5 atom % D |
| impurities | <=0.05% waterwater |
| InChI key | ZMXDDKWLCZADIW-YYWVXINBSA-N |
| refractive index | n20/D 1.428 (lit.) |
Description
N,N-Dimethylformamide-D7, >=99.5 Ato