01904 488599
Nitrofurantoin,Assay (Uv)
From £25.43 per (ex VAT)
Nitrofurantoin,Assay (Uv) (Ep) 98.0 To
| Product Code | N7878-10G |
|---|---|
| Unit of Measure | 1X10GR |
| CAS Number | 67-20-9 |
| MDL NUMBER | MFCD00003224 |
| EMPIRICAL FORMULA | C8H6N4O5 |
| Molecular Weight | 238.16 |
| Synonyms | N-(5-Nitro-2-Furfurylidene)-1-Aminohydantoin; Furadoxyl; Nitrofurantoine |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - N7878-10G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £26.59 |
| 12+ | 10% | £26.01 |
| 36+ | 12% | £25.43 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 67-20-9 |
| EINECSNo | 200-646-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Skin Sens. 1,Resp. Sens. 1 |
| GHS Hazard Codes | H302-H317-H334 |
| GHS Hazard Statements | Harmful if swallowed. May cause an allergic skin reaction. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| GHS Pictograms | GHS08,GHS07 |
| GHS Precaution Codes | P261 - P280 - P342 + P311 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. If experiencing respiratory symptoms: Call a POISON CENTER or doctor/ physician. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00003224 |
| Molecular Formula | C8H6N4O5 |
| Molecular Weight | 238.16 |
| Net Weight | 10 |
| R-Phrases | 22-42/43 |
| RTECSNo | MU2800000 |
| S-Phrases | 22-36/37-45 |
| Synonyms | N-(5-Nitro-2-furfurylidene)-1-aminohydantoin; Furadoxyl; Nitrofurantoine |
| Tariff Number | 29349990900 |
| Mode of action | cell wall synthesis | interferes |
| Quality Level | 200 |
| solubility | DMF: soluble 50 mg/mL |
| InChI key | NXFQHRVNIOXGAQ-YCRREMRBSA-N |
| SMILES string | [O-][N+](=O)c1ccc(C=NN2CC(=O)NC2=O)o1 |
| InChI | 1S/C8H6N4O5/c13-6-4-11(8(14)10-6)9-3-5-1-2-7(17-5)12(15)16/h1-3H,4H2,(H,10,13,14)/b9-3+ |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| form | (Crystalline Powder or crystals) |
| color | yellow |
| Assay | 98.0-102.0% (EP, UV) |
Description
Nitrofurantoin,Assay (Uv) (Ep) 98.0 To