01904 488599
Toluene-D8, 99 Atom % D
From £91.84 per (ex VAT)
Toluene-D8, 99 Atom % D
| Product Code | 151998-10G |
|---|---|
| Unit of Measure | 1X10GR |
| CAS Number | 2037-26-5 |
| MDL NUMBER | MFCD00044638 |
| EMPIRICAL FORMULA | C7H8 |
| Molecular Weight | 100.19 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 151998-10G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £103.04 |
| 12+ | 10% | £100.80 |
| 36+ | 12% | £98.56 |
| 72+ | 18% | £91.84 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12142201 |
| ADRSuff | 1 |
| CAS Number | 2037-26-5 |
| ADR Hazard Labels | 3 |
| ADR Number of Danger | 33 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Toluene |
| ADRNo | 1294 |
| Boiling Point | 110 C (lit.) |
| Density | 0.943 g/mL at 25 C (lit.) |
| Dual Use Material | X |
| EINECSNo | 218-009-5 |
| Flash Point | 4 C |
| GHS Categories | Flam. Liq. 2,Asp. Tox. 1,Skin Irrit. 2,Eye Irrit. 2,Acute Tox. 4,STOT SE 3,Repr. 2,STOT SE 2,STOT RE 2,Aquatic Chronic 2 |
| GHS Hazard Codes | H225-H304-H315-H319-H332-H336-H361d-H371-H373-H411 |
| GHS Hazard Statements | Highly flammable liquid and vapour. May be fatal if swallowed and enters airways. Causes skin irritation. Causes serious eye irritation. Harmful if inhaled. May cause drowsiness or dizziness. Suspected of damaging the unborn child. May cause damage to org |
| GHS Pictograms | GHS02,GHS08,GHS07,GHS09 |
| GHS Precaution Codes | P210 - P260 - P280 - P301 + P310 - P370 + P378 - P403 + P235 |
| GHS Precaution Statements | Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Use personal protective equipment as required. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. Do NOT induce vom |
| GHS Signal Words | Danger |
| Hazard Symbols | F,Xn |
| Hazard Symbols Descriptions | Highly flammable, Harmful |
| MDL Number | MFCD00044638 |
| Melting Point | -84 C (lit.) |
| Molecular Formula | C7H8 |
| Molecular Weight | 100.19 |
| Net Weight | 10 |
| R-Phrases | 63-11-38-48/20-65-67 |
| S-Phrases | 36/37-46-62 |
| Tariff Number | 28459010000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=151998brand=ALDRICH |
| refractive index | n20/D 1.494 (lit.) |
| isotopic purity | 99 atom % D |
| impurities | <=0.0100% waterwater |
| form | liquid |
| Quality Level | 100 |
| expl. lim. | 0.34-6.3 % (lit.) |
| technique(s) | NMR: suitable |
| SMILES string | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])([2H])[2H] |
| mp | -84 C (lit.) |
| bp | 110 C (lit.) |
| InChI key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| InChI | 1S/C7H8/c1-7-5-3-2-4-6-7/h2-6H,1H3/i1D3,2D,3D,4D,5D,6D |
| Assay | >=99.00% |
| mass shift | M+8 |
Description
Toluene-D8, 99 Atom % D