Acetone-D6, 99.9 Atom % D
From £525.00 per (ex VAT)
Acetone-D6, 99.9 Atom % D
| Product Code | 151793-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 666-52-4 |
| MDL NUMBER | MFCD00044635 |
| EMPIRICAL FORMULA | C3H6O |
| Molecular Weight | 64.12 |
| Synonyms | Hexadeuteroacetone |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12142201 |
| ADRSuff | 1 |
| CAS Number | 666-52-4 |
| ADR Hazard Labels | 3 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 33 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Acetone |
| ADRNo | 1090 |
| Boiling Point | 55.5 C (lit.) |
| Density | 0.872 g/mL at 25 C (lit.) |
| Dual Use Material | X |
| EINECSNo | 211-563-9 |
| Flash Point | -19 C - closed cup |
| GHS Categories | Flam. Liq. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H225-H319-H336 |
| GHS Hazard Statements | Highly flammable liquid and vapour. Causes serious eye irritation. May cause drowsiness or dizziness. |
| GHS Pictograms | GHS02,GHS07 |
| GHS Precaution Codes | P210 - P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Danger |
| Hazard Symbols | F,Xi |
| Hazard Symbols Descriptions | Highly flammable, Irritant |
| MDL Number | MFCD00044635 |
| Melting Point | -93.8 C (lit.) |
| Molecular Formula | C3H6O |
| Molecular Weight | 64.12 |
| Net Weight | 100 |
| R-Phrases | 11-36-66-67 |
| S-Phrases | 9-16-26 |
| Synonyms | Hexadeuteroacetone |
| Tariff Number | 28459010000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=151793brand=ALDRICH |
| Assay | >=99% (CP) |
| Quality Level | 200 |
| packaging | Sure/Seal(TM) of 100 g |
| mass shift | M+6 |
| bp | 55.5 C (lit.) |
| vapor pressure | 3.67 psi ( 20 C) |
| InChI | 1S/C3H6O/c1-3(2)4/h1-2H3/i1D3,2D3 |
| form | liquid |
| InChI key | CSCPPACGZOOCGX-WFGJKAKNSA-N |
| technique(s) | NMR: suitable |
| impurities | <=0.0500% waterwater |
| vapor density | 2 (vs air) |
| SMILES string | [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] |
| isotopic purity | 99.9 atom % D |
| mp | -93.8 C (lit.) |
| refractive index | n20/D 1.355 (lit.) |
| expl. lim. | 13.2 % |
Description
Acetone-D6, 99.9 Atom % D