01904 488599
Cis-1,2,3,6-Tetrahydrophthalic Anhydrid
From £91.90 per (ex VAT)
Cis-1,2,3,6-Tetrahydrophthalic Anhydrid
| Product Code | 136891-1KG |
|---|---|
| Unit of Measure | 1X1KG |
| CAS Number | 935-79-5 |
| MDL NUMBER | MFCD00005916 |
| EMPIRICAL FORMULA | C8H8O3 |
| Molecular Weight | 152.15 |
| Synonyms | Cis-4-Cyclohexene-1,2-Dicarboxylic Anhydride |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| InChI | 1S/C8H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-2,5-6H,3-4H2/t5-,6+ |
| Assay | 95% |
| form | flakes |
| SMILES string | [H][C@@]12CC=CC[C@]1([H])C(=O)OC2=O |
| vapor pressure | <0.01 mmHg ( 20 C) |
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12162002 |
| ADRSuff | 1 |
| CAS Number | 935-79-5 |
| ADR Hazard Labels | 8 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 80 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 8 |
| ADR Proper Shipping Name | Tetrahydrophthalic anhydrides |
| ADRNo | 2698 |
| EINECSNo | 213-308-7 |
| Flash Point | 156 C - closed cup |
| GHS Categories | Skin Sens. 1,Eye Dam. 1,Resp. Sens. 1,Aquatic Chronic 3 |
| GHS Hazard Codes | H317-H318-H334-H412 |
| GHS Hazard Statements | May cause an allergic skin reaction. Causes serious eye damage. May cause allergy or asthma symptoms or breathing difficulties if inhaled. Harmful to aquatic life with long lasting effects. |
| GHS Pictograms | GHS08,GHS05 |
| GHS Precaution Codes | P261 - P273 - P280 - P305 + P351 + P338 - P342 + P311 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Avoid release to the environment. Wear protective gloves/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00005916 |
| Melting Point | 97-103 C (lit.) |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 |
| Net Weight | 1 |
| Purity Grade | 0.95 |
| R-Phrases | 41-42/43-52/53 |
| S-Phrases | 22-24-26-37/39-61 |
| Synonyms | cis-4-Cyclohexene-1,2-dicarboxylic anhydride |
| Tariff Number | 29172000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=136891brand=ALDRICH |
| Quality Level | 100 |
| vapor density | 5.2 (vs air) |
| InChI key | KMOUUZVZFBCRAM-OLQVQODUSA-N |
| mp | 97-103 C (lit.) |
Description
Cis-1,2,3,6-Tetrahydrophthalic Anhydrid