01904 488599
Di-Tert-Butyl Azodicarboxylate, 98%
From £62.07 per (ex VAT)
Di-Tert-Butyl Azodicarboxylate, 98%
| Product Code | 135992-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 870-50-8 |
| MDL NUMBER | MFCD00015001 |
| EMPIRICAL FORMULA | CH18N2O4 |
| Molecular Weight | 230.26 |
| Synonyms | Bis(1,1-Dimethylethyl)Azodicarboxylate; Dbad; Di-Tert-Butyl Azodiformate; Nsc 109889 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 135992-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £69.64 |
| 12+ | 10% | £68.13 |
| 36+ | 12% | £66.62 |
| 72+ | 18% | £62.07 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352000 |
| ADRSuff | 1 |
| CAS Number | 870-50-8 |
| Storage Temperature | 2-8C |
| EINECSNo | 212-796-9 |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | - |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00015001 |
| Melting Point | 89-92 C (lit.) |
| Molecular Formula | CH18N2O4 |
| Molecular Weight | 230.26 |
| Net Weight | 25 |
| Purity Grade | 0.98 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Synonyms | Bis(1,1-dimethylethyl)azodicarboxylate; DBAD; Di-tert-butyl azodiformate; NSC 109889 |
| Tariff Number | 29270000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=135992brand=ALDRICH |
| Quality Level | 200 |
| InChI key | QKSQWQOAUQFORH-VAWYXSNFSA-N |
| greener alternative product characteristics | CatalysisLearn more about the Principles of Green Chemistry. |
| mp | 89-92 C (lit.) |
| storage temp. | 2-8C |
| InChI | 1S/C10H18N2O4/c1-9(2,3)15-7(13)11-12-8(14)16-10(4,5)6/h1-6H3/b12-11+ |
| SMILES string | CC(C)(C)OC(=O)N=NC(=O)OC(C)(C)C |
| form | solid |
| Assay | 98% |
| greener alternative category | Aligned |
Description
Di-Tert-Butyl Azodicarboxylate, 98%