01904 488599
Alizarin (Dye Content 97%)
£524.80 Each (ex VAT)
Alizarin (Dye Content 97%)
| Product Code | 122777-500G |
|---|---|
| Unit of Measure | 1X500GR |
| CAS Number | 72-48-0 |
| MDL NUMBER | MFCD00001201 |
| EMPIRICAL FORMULA | C14H8O4 |
| Molecular Weight | 240.21 |
| Synonyms | 1,2-Dihydroxyanthraquinone; Mordant Red 11 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 72-48-0 |
| Storage Temperature | room temp |
| EINECSNo | 200-782-5 |
| Flash Point | Not applicable |
| GHS Categories | Eye Irrit. 2 |
| GHS Hazard Codes | H319 |
| GHS Hazard Statements | Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P305 + P351 + P338 |
| GHS Precaution Statements | IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| MDL Number | MFCD00001201 |
| Melting Point | 279-283 C (lit.) |
| Molecular Formula | C14H8O4 |
| Molecular Weight | 240.21 |
| Net Weight | 500 |
| RTECSNo | CB6580000 |
| Synonyms | 1,2-Dihydroxyanthraquinone; Mordant Red 11 |
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=122777brand=SIAL |
| epsilon (extinction coefficient) | 13000 at 227-233 nm in 0.1 M NaOH at 0.01 g/L |
| Quality Level | 200 |
| Composition | Dye content, 97% |
| storage temp. | room temp |
| visual transition interval | 5.5-6.8, yellow to red(acid) |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| lambdamax | 609 nm |
| mp | 279-283 C (lit.) |
| solubility | 0.1 M NaOH: 0.01 g/L |
| form | solid |
| SMILES string | Oc1ccc2C(=O)c3ccccc3C(=O)c2c1O |
| InChI key | RGCKGOZRHPZPFP-UHFFFAOYSA-N |
| InChI | 1S/C14H8O4/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-6,15,18H |
Description
Alizarin (Dye Content 97%)