01904 488599
Capsaicin
From £227.22 per (ex VAT)
Capsaicin
| Product Code | 12084-50MG-F |
|---|---|
| Unit of Measure | 1X50MG |
| CAS Number | 404-86-4 |
| MDL NUMBER | MFCD00017259 |
| EMPIRICAL FORMULA | C18H27NO3 |
| Molecular Weight | 305.41 |
| Synonyms | 8-Methyl-N-Vanillyl-Trans-6-Nonenamide |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116000 |
| ADRSuff | C |
| CAS Number | 404-86-4 |
| ADR Hazard Labels | 6.1 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Alkaloids, solid, n.o.s. |
| ADRNo | 1544 |
| Storage Temperature | 2-8C |
| EINECSNo | 206-969-8 |
| Flash Point | 113 C - closed cup |
| GHS Categories | Acute Tox. 3,Skin Irrit. 2,Skin Sens. 1,Eye Dam. 1,Resp. Sens. 1,STOT SE 3 |
| GHS Hazard Codes | H301-H315-H317-H318-H334-H335 |
| GHS Hazard Statements | Toxic if swallowed. Causes skin irritation. May cause an allergic skin reaction. Causes serious eye damage. May cause allergy or asthma symptoms or breathing difficulties if inhaled. May cause respiratory irritation. |
| GHS Pictograms | GHS06,GHS08,GHS05 |
| GHS Precaution Codes | P261 - P280 - P280 - P284 - P301 + P330 + P331 + P310 - P305 + P351 + P338 + P310 |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00017259 |
| Melting Point | 62-65 C (lit.) |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.41 |
| Net Weight | 50 |
| R-Phrases | 25-36/37/38-42/43 |
| RTECSNo | RA8530000 |
| S-Phrases | 22-26-28-36/39-45 |
| Synonyms | 8-Methyl-N-vanillyl-trans-6-nonenamide |
| Tariff Number | 29397990900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=12084brand=SIAL |
| Application(s) | cleaning productscosmeticsflavors and fragrancesfood and beveragesforensics and toxicologypersonal carepharmaceutical (small molecule) |
| InChI | 1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+ |
| shelf life | limited shelf life, expiry date on the label |
| description | analytical standard for food analysis |
| InChI key | YKPUWZUDDOIDPM-SOFGYWHQSA-N |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| SMILES string | COc1cc(CNC(=O)CCCCC=CC(C)C)ccc1O |
| grade | analytical standard |
| Quality Level | 100 |
| Gene Information | human ... TRPV1(7442) |
| storage temp. | 2-8C |
| mp | 62-65 C (lit.) |
| Assay | >=98.5% (HPLC) |
| solubility | H2O: insoluble |
Description
Capsaicin