01904 488599
Venlafaxine Hydrochloride
From £119.84 per (ex VAT)
Venlafaxine Hydrochloride
| Product Code | V-004-1ML |
|---|---|
| Unit of Measure | 1X1ML |
| CAS Number | 99300-78-4 |
| EMPIRICAL FORMULA | C17H28ClNO2 |
| Molecular Weight | 313.86 |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | B |
| CAS Number | 99300-78-4 |
| ADR Hazard Labels | 3 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Methanol solution |
| ADR SubHaz Classes | 6.1 |
| ADRNo | 1230 |
| Storage Temperature | -20C |
| EINECSNo | 200-659-6 |
| Flash Point | 9.7 C - closed cup |
| GHS Categories | Flam. Liq. 2,Acute Tox. 3,Acute Tox. 3,Acute Tox. 3,STOT SE 1 |
| GHS Hazard Codes | H225-H301-H311-H331-H370 |
| GHS Hazard Statements | Highly flammable liquid and vapour. Toxic if swallowed. Toxic in contact with skin. Toxic if inhaled. Causes damage to organs. |
| GHS Pictograms | GHS02,GHS06,GHS08 |
| GHS Precaution Codes | P210 - P260 - P280 - P301 + P310 - P311 |
| GHS Signal Words | Danger |
| Hazard Symbols | F,T |
| Hazard Symbols Descriptions | Highly flammable, Toxic |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.86 |
| Net Weight | 3.4 |
| R-Phrases | 11-23/24/25-39/23/24/25 |
| S-Phrases | 7-16-36/37-45 |
| Tariff Number | 38220000900 |
| Quality Level | 300 |
| packaging | ampule of 1 mL |
| SMILES string | Cl.COc1ccc(cc1)C(CN(C)C)C2(O)CCCCC2 |
| feature | Snap-N-Spike(R)/Snap-N-Shoot(R) |
| concentration | 1.0 mg/mL in methanol (as free base) |
| form | liquid |
| InChI key | QYRYFNHXARDNFZ-UHFFFAOYSA-N |
| technique(s) | gas chromatography (GC): suitable |
| grade | certified reference material |
| InChI | 1S/C17H27NO2.ClH/c1-18(2)13-16(17(19)11-5-4-6-12-17)14-7-9-15(20-3)10-8-14;/h7-10,16,19H,4-6,11-13H2,1-3H3;1H |
| storage temp. | -20C |
| format | single component solution |
| Application(s) | clinical testing |
| Gene Information | human ... SLC6A2(6530), SLC6A4(6532) |
| manufacturer/tradename | Cerilliant(R) |
Description
Venlafaxine Hydrochloride