01904 488599
Thimerosal Titration (On Dried Substanc
From £306.44 per (ex VAT)
Thimerosal Titration (On Dried Substanc
| Product Code | T5125-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 54-64-8 |
| MDL NUMBER | MFCD00013062 |
| EMPIRICAL FORMULA | C9H9HgNaO2S |
| Molecular Weight | 404.81 |
| Synonyms | 2-(Ethylmercuriomercapto)Benzoic Acid Sodium Salt; Ethylmercurithiosalicylic Acid Sodium Salt; Mercury-([O-Carboxyphenyl]Thio)Ethyl Sodium Salt; Sodium Ethylmercurithiosalicylate |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - T5125-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 5% | £309.70 |
| 12+ | 6% | £306.44 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | C |
| CAS Number | 54-64-8 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 60 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Mercury compound, solid, n.o.s. |
| ADRNo | 2025 |
| Storage Temperature | room temp |
| EINECSNo | 200-210-4 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 2,Acute Tox. 1,Acute Tox. 2,STOT RE 2,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H300-H310-H330-H373-H400-H410 |
| GHS Hazard Statements | Fatal if swallowed. Fatal in contact with skin. Fatal if inhaled. May cause damage to organs through prolonged or repeated exposure. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS06,GHS08,GHS09 |
| GHS Precaution Codes | P260 - P273 - P280 - P301 + P310 + P330 - P302 + P352 + P310 - P304 + P340 + P310 |
| GHS Precaution Statements | Do not breathe dust/ fume/ gas/ mist/ vapours/ spray. Wash hands thoroughly after handling. Avoid release to the environment. Wear protective gloves/ protective clothing. Wear respiratory protection. IF SWALLOWED: Immediately call a POISON CENTER or docto |
| GHS Signal Words | Danger |
| Hazard Symbols | T+,N |
| Hazard Symbols Descriptions | Very toxic, Dangerous for the environment |
| MDL Number | MFCD00013062 |
| Melting Point | 234-237 C (dec.) (lit.) |
| Molecular Formula | C9H9HgNaO2S |
| Molecular Weight | 404.81 |
| Net Weight | 25 |
| R-Phrases | 26/27/28-33-50/53 |
| S-Phrases | 13-28-36-45-60-61 |
| Synonyms | 2-(Ethylmercuriomercapto)benzoic acid sodium salt; Ethylmercurithiosalicylic acid sodium salt; Mercury-([o-carboxyphenyl]thio)ethyl sodium salt; Sodium ethylmercurithiosalicylate |
| Tariff Number | 28521000000 |
| Technical Name | 2-(ETHYLMERCURIOMERCAPTO)BENZOIC ACID SODIUM SALT |
| mp | 234-237 C (dec.) (lit.) |
| InChI | 1S/C7H6O2S.C2H5.Hg.Na/c8-7(9)5-3-1-2-4-6(5)10;1-2;;/h1-4,10H,(H,8,9);1H2,2H3;;/q;;2*+1/p-2 |
| Quality Level | 200 |
| InChI key | RTKIYNMVFMVABJ-UHFFFAOYSA-L |
| form | powder or crystals |
| Assay | 97.0-101.0% (on dried substance, titration) |
| Mode of action | enzyme | inhibits |
| storage temp. | room temp |
| SMILES string | [Na+].CC[Hg]Sc1ccccc1C([O-])=O |
| color | white to faint beige |
Description
Thimerosal Titration (On Dried Substanc