01904 488599
P-Toluenesulfonyl Isocyanate, 96%
From £36.41 per (ex VAT)
P-Toluenesulfonyl Isocyanate, 96%
| Product Code | 189278-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 4083-64-1 |
| MDL NUMBER | MFCD00002030 |
| EMPIRICAL FORMULA | C8H7NO3S |
| Molecular Weight | 197.21 |
| Synonyms | Tosyl Isocyanate |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 189278-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £40.85 |
| 12+ | 10% | £39.96 |
| 36+ | 12% | £39.07 |
| 72+ | 18% | £36.41 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | CS |
| CAS Number | 4083-64-1 |
| ADR Hazard Labels | 6.1 |
| ADR Number of Danger | 60 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Isocyanates, toxic, n.o.s. |
| ADRNo | 2206 |
| Boiling Point | 144 C/10 mmHg (lit.); 275-278 C (lit.) |
| Density | 1.291 g/mL at 25 C (lit.) |
| EINECSNo | 223-810-8 |
| Flash Point | 145 C - closed cup |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,Acute Tox. 3,Resp. Sens. 1,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H331-H334-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. Toxic if inhaled. May cause allergy or asthma symptoms or breathing difficulties if inhaled. May cause respiratory irritation. |
| GHS Pictograms | GHS06,GHS08 |
| GHS Precaution Codes | P261 - P284 - P304 + P340 + P311 - P305 + P351 + P338 - P342 + P311 - P403 + P233 |
| GHS Precaution Statements | IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. If experiencing respiratory symptoms: Call a POISON CENTER or doctor/ physician. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00002030 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.21 |
| Net Weight | 25 |
| Purity Grade | 0.96 |
| R-Phrases | 14-36/37/38-42 |
| RTECSNo | DB9032000 |
| S-Phrases | 26-28-30 |
| Synonyms | Tosyl isocyanate |
| Tariff Number | 29359090990 |
| Technical Name | P-TOLUENESULFONYL ISOCYANATE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=189278brand=ALDRICH |
| refractive index | n20/D 1.534 (lit.) |
| Quality Level | 200 |
| bp | 144 C/10 mmHg (lit.) |
| InChI | 1S/C8H7NO3S/c1-7-2-4-8(5-3-7)13(11,12)9-6-10/h2-5H,1H3 |
| form | liquid |
| SMILES string | Cc1ccc(cc1)S(=O)(=O)N=C=O |
| Assay | 96% |
| vapor pressure | 1 mmHg ( 100 C) |
| InChI key | VLJQDHDVZJXNQL-UHFFFAOYSA-N |
Description
P-Toluenesulfonyl Isocyanate, 96%