01904 488599
Fast Red Violet Lb Salt, Dye Content >=
From £20.45 per (ex VAT)
Fast Red Violet Lb Salt, Dye Content >=
| Product Code | F3381-100MG |
|---|---|
| Unit of Measure | 1X100MG |
| CAS Number | 32348-81-5 |
| MDL NUMBER | MFCD00011892 |
| EMPIRICAL FORMULA | C14H11Cl2N3O |
| Molecular Weight | 376.31 |
| Synonyms | 5-Chloro-4-Benzamido-2-Methylbenzenediazonium Chloride Hemi(Zinc Chloride) Salt |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - F3381-100MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £23.29 |
| 12+ | 20% | £22.72 |
| 36+ | 22% | £22.15 |
| 72+ | 28% | £20.45 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 32348-81-5 |
| Storage Temperature | room temp |
| GHS Categories | Acute Tox. 4,Acute Tox. 4,Acute Tox. 4,Carc. 2 |
| GHS Hazard Codes | H302-H312-H332-H351 |
| GHS Hazard Statements | Harmful if swallowed. Harmful in contact with skin. Harmful if inhaled. Suspected of causing cancer. |
| GHS Pictograms | GHS08,GHS07 |
| GHS Precaution Codes | P261 - P280 - P301 + P312 + P330 |
| GHS Precaution Statements | Wear protective gloves/ protective clothing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00011892 |
| Molecular Formula | C14H11Cl2N3O |
| Molecular Weight | 376.31 |
| Net Weight | 100 |
| R-Phrases | 20/21/22-40 |
| S-Phrases | 22-36 |
| Synonyms | 5-Chloro-4-benzamido-2-methylbenzenediazonium chloride hemi(zinc chloride) salt |
| Tariff Number | 32129000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=F3381brand=SIGMA |
| Composition | Dye content, >=90% |
| InChI key | SARKXLKWFKNUMR-UHFFFAOYSA-N |
| InChI | 1S/C14H10ClN3O.ClH/c1-9-7-13(11(15)8-12(9)18-16)17-14(19)10-5-3-2-4-6-10;/h2-8H,1H3;1H |
| storage temp. | room temp |
| form | powder |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | H2O: 1 mg/mL |
| SMILES string | [Cl-].Cc1cc(NC(=O)c2ccccc2)c(Cl)cc1[N+]#N |
| Quality Level | 100 |
Description
Fast Red Violet Lb Salt, Dye Content >=