01904 488599
Fenthion Oxon Sulfone-(S-Methyl-D3)
From £317.22 per (ex VAT)
Fenthion Oxon Sulfone-(S-Methyl-D3)
| Product Code | 90039-5MG |
|---|---|
| Unit of Measure | 1X5MG |
| EMPIRICAL FORMULA | CH15O6PS |
| Molecular Weight | 297.28 |
| Synonyms | Dimethyl 3-Methyl-4-(Methyl-D3-Sulfonyl)Phenyl Phosphate; Fenoxon Sulfone-(S-Methyl-D3) |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | B |
| ADR Hazard Labels | 6.1 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| Storage Temperature | 2-8C |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 2 |
| GHS Hazard Codes | H300 |
| GHS Hazard Statements | Fatal if swallowed. |
| GHS Pictograms | GHS06 |
| GHS Precaution Codes | P301 + P330 + P331 + P310 |
| GHS Signal Words | Danger |
| Melting Point | 40-46 C |
| Molecular Formula | CH15O6PS |
| Molecular Weight | 297.28 |
| Net Weight | 5 |
| Synonyms | Dimethyl 3-methyl-4-(methyl-d3-sulfonyl)phenyl phosphate; Fenoxon sulfone-(S-methyl-d3) |
| Tariff Number | 28459010000 |
| Assay | >=98.0% (HPLC) |
| shelf life | limited shelf life, expiry date on the label |
| format | neat |
| grade | analytical standard |
| Quality Level | 100 |
| storage temp. | 2-8C |
| mp | 40-46 C |
| product line | PESTANAL(R) |
| Application(s) | agriculture |
| SMILES string | O=P(OC)(OC)OC1=CC(C)=C(S(=O)(C([2H])([2H])[2H])=O)C=C1 |
Description
Fenthion Oxon Sulfone-(S-Methyl-D3)