01904 488599
Tetrabutylammonium Benzoate,Electro-
From £325.54 per (ex VAT)
Tetrabutylammonium Benzoate,Electro-
| Product Code | 86837-25G |
|---|---|
| Unit of Measure | 1X25GR |
| CAS Number | 18819-89-1 |
| MDL NUMBER | MFCD00171701 |
| EMPIRICAL FORMULA | C23H41NO2 |
| Molecular Weight | 363.58 |
| Brand | SUPELCO |
Tiered Pricing - 86837-25G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £365.24 |
| 12+ | 10% | £357.30 |
| 36+ | 12% | £349.36 |
| 72+ | 18% | £325.54 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 26111700 |
| ADRSuff | 1 |
| CAS Number | 18819-89-1 |
| Flash Point | Not applicable |
| GHS Categories | Skin Irrit. 2,Eye Irrit. 2,STOT SE 3 |
| GHS Hazard Codes | H315-H319-H335 |
| GHS Hazard Statements | Causes skin irritation. Causes serious eye irritation. May cause respiratory irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P261 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00171701 |
| Melting Point | 64-67 C (lit.) |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.58 |
| Net Weight | 25 |
| R-Phrases | 36/37/38 |
| S-Phrases | 26-36 |
| Tariff Number | 29239000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=86837brand=SIAL |
| form | crystals |
| InChI key | WGYONVRJGWHMKV-UHFFFAOYSA-M |
| Assay | >=99.0% |
| solubility | acetonitrile: 0.1 g/mL, clear, colorless |
| SMILES string | [O-]C(=O)c1ccccc1.CCCC[N+](CCCC)(CCCC)CCCC |
| Quality Level | 100 |
| InChI | 1S/C16H36N.C7H6O2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;8-7(9)6-4-2-1-3-5-6/h5-16H2,1-4H3;1-5H,(H,8,9)/q+1;/p-1 |
| mp | 64-67 C (lit.) |
| grade | for electrochemical analysis |
Description
Tetrabutylammonium Benzoate,Electro-