01904 488599
Wright Stain Solution, For Microsc.
From £92.88 per (ex VAT)
Wright Stain Solution, For Microsc.
| Product Code | 45253-1L-F |
|---|---|
| Unit of Measure | 1X1LT |
| MDL NUMBER | MFCD00005038 |
| Synonyms | Eosin Methylene Blue Solution According To Wright; Wright'S Eosin Methylene Blue |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 45253-1L-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £105.78 |
| 12+ | 20% | £103.20 |
| 36+ | 22% | £100.62 |
| 72+ | 28% | £92.88 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | B |
| ADR Hazard Labels | 3 |
| ADR Number of Danger | 336 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Methanol solution |
| ADR SubHaz Classes | 6.1 |
| ADRNo | 1230 |
| Storage Temperature | 2-8C |
| Density | 0.80 g/mL at 20 C |
| Flash Point | 11 C |
| GHS Categories | Flam. Liq. 2,Acute Tox. 3,Acute Tox. 3,Eye Irrit. 2,Acute Tox. 3,STOT SE 1 |
| GHS Hazard Codes | H225-H301-H311-H319-H331-H370 |
| GHS Hazard Statements | Highly flammable liquid and vapour. Toxic if swallowed. Toxic in contact with skin. Causes serious eye irritation. Toxic if inhaled. Causes damage to organs. |
| GHS Pictograms | GHS02,GHS06,GHS08 |
| GHS Precaution Codes | P210 - P260 - P280 - P301 + P310 + P330 - P308 + P311 - P403 + P233 |
| GHS Precaution Statements | Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Do not breathe dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ eye protection/ face protection. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. IF IN EY |
| GHS Signal Words | Danger |
| Hazard Symbols | F,T |
| Hazard Symbols Descriptions | Highly flammable, Toxic |
| MDL Number | MFCD00005038 |
| Net Weight | 0.8 |
| R-Phrases | 11-23/24/25-39/23/24/25-41 |
| S-Phrases | 16-26-36/37/39-45 |
| Synonyms | Eosin Methylene blue solution according to Wright; Wright's eosin methylene blue |
| Tariff Number | 32129000000 |
| shelf life | limited shelf life, expiry date on the label |
| SMILES string | [K+].COC(=O)c1ccccc1C2=C3C=C(Br)C(=O)C(Br)=C3Oc4c(Br)c([O-])c(Br)cc24 |
| suitability | Histoplasma spp. |
| technique(s) | microbe id | staining: suitable |
| Quality Level | 100 |
| impurities | methanol |
| grade | for microscopy |
| InChI | 1S/C21H10Br4O5.K/c1-29-21(28)9-5-3-2-4-8(9)14-10-6-12(22)17(26)15(24)19(10)30-20-11(14)7-13(23)18(27)16(20)25;/h2-7,26H,1H3;/q;+1/p-1 |
| InChI key | NXBZXYJXNIFCRJ-UHFFFAOYSA-M |
Description
Wright Stain Solution, For Microsc.