01904 488599
Chrysene-D12, 98 Atom % D
From £301.00 per (ex VAT)
Chrysene-D12, 98 Atom % D
| Product Code | 364614-250MG |
|---|---|
| Unit of Measure | 1X250MG |
| CAS Number | 1719-03-5 |
| MDL NUMBER | MFCD00134283 |
| EMPIRICAL FORMULA | C18H12 |
| Molecular Weight | 240.36 |
| Synonyms | Dodecadeuteriochrysene |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 1719-03-5 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 90 |
| Boiling Point | 448 C (lit.) |
| Dual Use Material | X |
| Flash Point | Not applicable |
| GHS Categories | Muta. 2,Carc. 1B,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H341-H350-H400-H410 |
| GHS Hazard Statements | Suspected of causing genetic defects. May cause cancer. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS08,GHS09 |
| GHS Precaution Codes | P201 - P273 - P281 - P308 + P313 - P501 |
| GHS Precaution Statements | Obtain special instructions before use. Avoid release to the environment. Use personal protective equipment as required. IF exposed or concerned: Get medical advice/ attention. Dispose of contents/ container to an approved waste disposal plant. |
| GHS Signal Words | Danger |
| Hazard Symbols | T,N |
| Hazard Symbols Descriptions | Toxic, Dangerous for the environment |
| MDL Number | MFCD00134283 |
| Melting Point | 252-254 C (lit.) |
| Molecular Formula | C18H12 |
| Molecular Weight | 240.36 |
| Net Weight | 250 |
| R-Phrases | 45-50/53-68 |
| S-Phrases | 53-45-60-61 |
| Synonyms | Dodecadeuteriochrysene |
| Tariff Number | 28459010000 |
| Technical Name | CHRYSENE-D12 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=364614brand=ALDRICH |
| bp | 448 C (lit.) |
| Quality Level | 200 |
| InChI | 1S/C18H12/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D |
| mass shift | M+12 |
| isotopic purity | 98 atom % D |
| Assay | 99% (CP) |
| SMILES string | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c3c4c([2H])c([2H])c([2H])c([2H])c4c([2H])c([2H])c23 |
| mp | 252-254 C (lit.) |
| InChI key | WDECIBYCCFPHNR-AQZSQYOVSA-N |
Description
Chrysene-D12, 98 Atom % D