01904 488599
Hexazinone Pestanal.
From £60.60 per (ex VAT)
Hexazinone Pestanal.
| Product Code | 36129-100MG |
|---|---|
| Unit of Measure | 1X100MG |
| CAS Number | 51235-04-2 |
| MDL NUMBER | MFCD00055526 |
| EMPIRICAL FORMULA | C12H2N4O2 |
| Molecular Weight | 252.31 |
| Brand | SUPELCO |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 41116107 |
| ADRSuff | 1 |
| CAS Number | 51235-04-2 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 90 |
| EINECSNo | 257-074-4 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Eye Irrit. 2,Aquatic Acute 1,Aquatic Chronic 1 |
| GHS Hazard Codes | H302-H319-H400-H410 |
| GHS Hazard Statements | Harmful if swallowed. Causes serious eye irritation. Very toxic to aquatic life. Very toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS07,GHS09 |
| GHS Precaution Codes | P273 - P305 + P351 + P338 - P501 |
| GHS Precaution Statements | Avoid release to the environment. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Dispose of contents/ container to an approved waste disposal plant. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn,N |
| Hazard Symbols Descriptions | Harmful, Dangerous for the environment |
| MDL Number | MFCD00055526 |
| Molecular Formula | C12H2N4O2 |
| Molecular Weight | 252.31 |
| Net Weight | 100 |
| R-Phrases | 22-36-50/53 |
| RTECSNo | XY7850000 |
| S-Phrases | 60-61 |
| Tariff Number | 29336980900 |
| Technical Name | HEXAZINONE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=36129brand=SIAL |
| shelf life | limited shelf life, expiry date on the label |
| format | neat |
| technique(s) | gas chromatography (GC): suitable |
| grade | analytical standard |
| Quality Level | 100 |
| Application(s) | agricultureenvironmental |
| product line | PESTANAL(R) |
| SMILES string | CN(C)C1=NC(=O)N(C2CCCCC2)C(=O)N1C |
| InChI key | CAWXEEYDBZRFPE-UHFFFAOYSA-N |
| InChI | 1S/C12H20N4O2/c1-14(2)10-13-11(17)16(12(18)15(10)3)9-7-5-4-6-8-9/h9H,4-8H2,1-3H3 |
Description
Hexazinone Pestanal.