01904 488599
5-Sulfosalicylic Acid Dihydrate, Reagent
From £27.02 per (ex VAT)
5-Sulfosalicylic Acid Dihydrate, Reagent
| Product Code | S2130-100G |
|---|---|
| Unit of Measure | 1X100GR |
| CAS Number | 5965-83-3 |
| MDL NUMBER | MFCD00149540 |
| EMPIRICAL FORMULA | C7H6O6S |
| Molecular Weight | 254.21 |
| Synonyms | 2-Hydroxy-5-Sulfobenzoic Acid |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - S2130-100G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £28.24 |
| 12+ | 10% | £27.63 |
| 36+ | 12% | £27.02 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352100 |
| ADRSuff | 1 |
| CAS Number | 5965-83-3 |
| EINECSNo | 202-555-6 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Skin Irrit. 2,Eye Irrit. 2 |
| GHS Hazard Codes | H302-H315-H319 |
| GHS Hazard Statements | Harmful if swallowed. Causes skin irritation. Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P301 + P312 + P330 - P305 + P351 + P338 |
| GHS Precaution Statements | Wear protective gloves/ protective clothing/ eye protection/ face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Immediately call a POISON CENTER or doctor/ phys |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00149540 |
| Melting Point | 105-110 C (lit.) |
| Molecular Formula | C7H6O6S |
| Molecular Weight | 254.21 |
| Net Weight | 100 |
| R-Phrases | 22-36/37/38 |
| S-Phrases | 26-36/37/39-45 |
| Synonyms | 2-Hydroxy-5-sulfobenzoic acid |
| Tariff Number | 29182900190 |
| InChI key | BHDKTFQBRFWJKR-UHFFFAOYSA-N |
| Quality Level | 200 |
| mp | 105-110 C (lit.) |
| InChI | 1S/C7H6O6S.2H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;/h1-3,8H,(H,9,10)(H,11,12,13);2*1H2 |
| Assay | >=99% |
| SMILES string | [H]O[H].[H]O[H].OC(=O)c1cc(ccc1O)S(O)(=O)=O |
| product line | ReagentPlus(R) |
| solubility | water: soluble 100 mg/mL, clear, colorless |
Description
5-Sulfosalicylic Acid Dihydrate, Reagent