01904 488599
Crystal Violet Solution
From £68.70 per (ex VAT)
Crystal Violet Solution
| Product Code | HT901-8FOZ |
|---|---|
| Unit of Measure | 1X8FOZ |
| CAS Number | 548-62-9 |
| MDL NUMBER | MFCD00011750 |
| EMPIRICAL FORMULA | C25H3ClN3 |
| Molecular Weight | 407.98 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | C |
| CAS Number | 548-62-9 |
| ADR Hazard Labels | 3 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 30 |
| ADR Packing Group | 3 |
| ADR Primary Hazard Class | 3 |
| ADR Proper Shipping Name | Flammable liquid, n.o.s. |
| ADRNo | 1993 |
| Storage Temperature | room temp |
| Flash Point | 37.8 C - closed cup |
| GHS Categories | Flam. Liq. 3,Eye Irrit. 2,Carc. 2,Aquatic Chronic 2 |
| GHS Hazard Codes | H226-H319-H351-H411 |
| GHS Hazard Statements | Flammable liquid and vapour. Causes serious eye irritation. Suspected of causing cancer. Toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS02,GHS08,GHS07,GHS09 |
| GHS Precaution Codes | P273 - P281 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid release to the environment. Use personal protective equipment as required. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn,N |
| Hazard Symbols Descriptions | Harmful, Dangerous for the environment |
| MDL Number | MFCD00011750 |
| Molecular Formula | C25H3ClN3 |
| Molecular Weight | 407.98 |
| Net Weight | 85.049 |
| R-Phrases | 10-40-51/53 |
| S-Phrases | 36/37-61 |
| Tariff Number | 32129000000 |
| Technical Name | ETHANOL, METHANOL |
| pH | 4.6 |
| concentration | 2.3% |
| Quality Level | 500 |
| storage temp. | room temp |
| SMILES string | [Cl-].CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)=C3/C=CC(C=C3)=[N+](/C)C |
| IVD | for in vitro diagnostic use |
| shelf life | Expiry date on the label |
| InChI key | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
| InChI | 1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1 |
| form | solution |
| Application(s) | hematologyhistology |
Description
Crystal Violet Solution