01904 488599
Dipentyl Phthalate
From £46.25 per (ex VAT)
Dipentyl Phthalate
| Product Code | 80154-1ML |
|---|---|
| Unit of Measure | 1X1ML |
| CAS Number | 131-18-0 |
| MDL NUMBER | MFCD00041934 |
| EMPIRICAL FORMULA | C18H26O4 |
| Molecular Weight | 306.4 |
| Brand | SUPELCO |
Tiered Pricing - 80154-1ML
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £51.89 |
| 12+ | 10% | £50.76 |
| 36+ | 12% | £49.63 |
| 72+ | 18% | £46.25 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 26111700 |
| ADRSuff | 1 |
| CAS Number | 131-18-0 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 90 |
| Density | 1.025 g/mL at 20 C (lit.) |
| EINECSNo | 205-017-9 |
| Flash Point | 118 C - closed cup |
| GHS Categories | Repr. 1B,Aquatic Acute 1 |
| GHS Hazard Codes | H360-H400 |
| GHS Hazard Statements | May damage fertility or the unborn child. Very toxic to aquatic life. |
| GHS Pictograms | GHS08,GHS09 |
| GHS Precaution Codes | P201 - P273 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. Avoid release to the environment. IF exposed or concerned: Get medical advice/ attention. |
| GHS Signal Words | Danger |
| Hazard Symbols | T,N |
| Hazard Symbols Descriptions | Toxic, Dangerous for the environment |
| MDL Number | MFCD00041934 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.4 |
| Net Weight | 1.025 |
| R-Phrases | 60-61-50 |
| RTECSNo | TI1930000 |
| S-Phrases | 53-45-61 |
| Tariff Number | 29173400550 |
| Technical Name | DIPENTYL PHTHALATE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=80154brand=SIAL |
| Quality Level | 200 |
| Assay | >=99.0% |
| form | liquid |
| InChI | 1S/C18H26O4/c1-3-5-9-13-21-17(19)15-11-7-8-12-16(15)18(20)22-14-10-6-4-2/h7-8,11-12H,3-6,9-10,13-14H2,1-2H3 |
| refractive index | n20/D 1.490 |
| SMILES string | CCCCCOC(=O)c1ccccc1C(=O)OCCCCC |
| product line | Selectophore(TM) |
| InChI key | IPKKHRVROFYTEK-UHFFFAOYSA-N |
| grade | for ion-selective electrodes |
Description
Dipentyl Phthalate