01904 488599
Cycloheximide, Biotechnology Performance
From £417.00 per (ex VAT)
Cycloheximide, Biotechnology Performance
| Product Code | C1988-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 66-81-9 |
| MDL NUMBER | MFCD00082346 |
| EMPIRICAL FORMULA | C15H23NO4 |
| Molecular Weight | 281.35 |
| Synonyms | 3-[2-(3,5-Dimethyl-2-Oxocyclohexyl)-2-Hydroxyethyl]Glutarimide; Actidione; Naramycin A |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | A |
| CAS Number | 66-81-9 |
| ADR Hazard Labels | 6.1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 66 |
| ADR Packing Group | 1 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| Storage Temperature | 2-8C |
| EINECSNo | 200-636-0 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 2,Muta. 2,Repr. 1B,Aquatic Chronic 2 |
| GHS Hazard Codes | H300-H341-H360D-H411 |
| GHS Hazard Statements | Fatal if swallowed. Suspected of causing genetic defects. May damage the unborn child. Toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS06,GHS08,GHS09 |
| GHS Precaution Codes | P201 - P280 - P301 + P330 + P331 + P310 - P308 + P313 |
| GHS Precaution Statements | Obtain special instructions before use. Wash hands thoroughly after handling. Avoid release to the environment. Use personal protective equipment as required. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. IF exposed or concerned: Ge |
| GHS Signal Words | Danger |
| Hazard Symbols | T+,N |
| Hazard Symbols Descriptions | Very toxic, Dangerous for the environment |
| MDL Number | MFCD00082346 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 |
| Net Weight | 5 |
| R-Phrases | 61-28-38-51/53-68 |
| RTECSNo | MA4375000 |
| S-Phrases | 53-45-61 |
| Synonyms | 3-[2-(3,5-Dimethyl-2-oxocyclohexyl)-2-hydroxyethyl]glutarimide; Actidione; Naramycin A |
| Tariff Number | 29419000000 |
| Technical Name | CYCLOHEXIMIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C1988brand=SIGMA |
| Antibiotic Activity Spectrum | fungi |
| impurities | endotoxin, tested |
| Quality Level | 200 |
| Mode of action | protein synthesis | interferes |
| InChI key | YPHMISFOHDHNIV-FSZOTQKASA-N |
| SMILES string | [H][C@]1(C[C@@H](C)C[C@H](C)C1=O)[C@H](O)CC2CC(=O)NC(=O)C2 |
| technique(s) | cell culture | mammalian: suitable |
| grade | Biotechnology Performance Certified |
| storage temp. | 2-8C |
| solubility | ethanol: 50 mg/mL |
| InChI | 1S/C15H23NO4/c1-8-3-9(2)15(20)11(4-8)12(17)5-10-6-13(18)16-14(19)7-10/h8-12,17H,3-7H2,1-2H3,(H,16,18,19)/t8-,9-,11-,12+/m0/s1 |
| Gene Information | human ... FKBP1A(2280), PIN1(5300) |
| form | powder |
Description
Cycloheximide, Biotechnology Performance