01904 488599
Ampicillin Sodium Salt, Bioreagent, Po
From £85.47 per (ex VAT)
Ampicillin Sodium Salt, Bioreagent, Po
| Product Code | A0166-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 69-52-3 |
| MDL NUMBER | MFCD00064313 |
| EMPIRICAL FORMULA | C16H18N3NaO4S |
| Molecular Weight | 371.39 |
| Synonyms | D-(-)-Alpha-Aminobenzylpenicillin Sodium Salt |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - A0166-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £96.57 |
| 12+ | 15% | £94.35 |
| 36+ | 17% | £92.13 |
| 72+ | 23% | £85.47 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 69-52-3 |
| Storage Temperature | 2-8C |
| EINECSNo | 200-708-1 |
| Flash Point | Not applicable |
| GHS Categories | Skin Sens. 1,Resp. Sens. 1 |
| GHS Hazard Codes | H317-H334 |
| GHS Hazard Statements | May cause an allergic skin reaction. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P261 - P280 - P342 + P311 |
| GHS Precaution Statements | Wear protective gloves. If experiencing respiratory symptoms: Call a POISON CENTER or doctor/ physician. |
| GHS Signal Words | Danger |
| Hazard Symbols | Xn |
| Hazard Symbols Descriptions | Harmful |
| MDL Number | MFCD00064313 |
| Melting Point | 215 C (dec.) (lit.) |
| Molecular Formula | C16H18N3NaO4S |
| Molecular Weight | 371.39 |
| Net Weight | 5 |
| R-Phrases | 42/43 |
| RTECSNo | XH8400000 |
| S-Phrases | 22-36/37-45 |
| Synonyms | D-(-)-alpha-Aminobenzylpenicillin sodium salt |
| Tariff Number | 29411000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=A0166brand=SIGMA |
| mp | 215 C (dec.) (lit.) |
| potency | 845-988 mug per mg (C16H18N3O4S, Calculated on the anhydrous basis) |
| Mode of action | cell wall synthesis | interferes |
| Quality Level | 200 |
| storage temp. | 2-8C |
| product line | BioReagent |
| SMILES string | [Na+].CC1(C)SC2[C@H](NC(=O)[C@H](N)c3ccccc3)C(=O)N2[C@H]1C([O-])=O |
| form | powder or crystals |
| biological source | synthetic |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| InChI | 1S/C16H19N3O4S.Na/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8;/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23);/q;+1/p-1/t9-,10-,11+,14-;/m1./s1 |
| technique(s) | cell culture | mammalian: suitable |
| InChI key | KLOHDWPABZXLGI-YWUHCJSESA-M |
| solubility | H2O: 50 mg/mL (Stock solutions should be stored at -20Â C.) |
| color | white to off-white |
Description
Ampicillin Sodium Salt, Bioreagent, Po