01904 488599
Cephradine >=90.0% (Hplc)
From £76.92 per (ex VAT)
Cephradine >=90.0% (Hplc)
| Product Code | C8395-500MG |
|---|---|
| Unit of Measure | 1X500MG |
| CAS Number | 38821-53-3 |
| MDL NUMBER | MFCD00865048 |
| EMPIRICAL FORMULA | C16H19N3O4S |
| Molecular Weight | 349.4 |
| Synonyms | Cefradin |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - C8395-500MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 13% | £86.91 |
| 12+ | 15% | £84.92 |
| 36+ | 17% | £82.92 |
| 72+ | 23% | £76.92 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12350000 |
| ADRSuff | 1 |
| CAS Number | 38821-53-3 |
| Storage Temperature | 2-8C |
| Flash Point | Not applicable |
| GHS Categories | Skin Sens. 1,Resp. Sens. 1 |
| GHS Hazard Codes | H317-H334 |
| GHS Hazard Statements | May cause an allergic skin reaction. May cause allergy or asthma symptoms or breathing difficulties if inhaled. |
| GHS Pictograms | GHS08 |
| GHS Precaution Codes | P261 - P280 - P284 - P304 + P340 - P342 + P311 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. If experiencing respiratory symptoms: Call a PO |
| GHS Signal Words | Danger |
| MDL Number | MFCD00865048 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.4 |
| Net Weight | 500 |
| Synonyms | Cefradin |
| Tariff Number | 29419000000 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=C8395brand=SIGMA |
| solubility | ethanol: practically insoluble 96% |
| Mode of action | cell wall synthesis | interferes |
| Quality Level | 200 |
| storage temp. | 2-8C |
| InChI | 1S/C16H19N3O4S/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9/h2-3,6,10-11,15H,4-5,7,17H2,1H3,(H,18,20)(H,22,23)/t10-,11-,15-/m1/s1 |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| SMILES string | [H][C@]12SCC(C)=C(N1C(=O)[C@H]2NC(=O)[C@H](N)C3=CCC=CC3)C(O)=O |
| form | powder |
| Assay | >=90.0% (Cephradine, HPLC) |
| InChI key | RDLPVSKMFDYCOR-UEKVPHQBSA-N |
Description
Cephradine >=90.0% (Hplc)