Crystal Violet Solution, 1% Aqueous
From £81.30 per (ex VAT)
Crystal Violet Solution, 1% Aqueous
| Product Code | V5265-500ML |
|---|---|
| Unit of Measure | 1X500ML |
| CAS Number | 548-62-9 |
| MDL NUMBER | MFCD00011750 |
| EMPIRICAL FORMULA | C25H3ClN3 |
| Molecular Weight | 407.98 |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352200 |
| ADRSuff | 1 |
| CAS Number | 548-62-9 |
| ADR Number of Danger | 90 |
| Storage Temperature | room temp |
| Flash Point | Not applicable |
| GHS Categories | Eye Irrit. 2,Carc. 2,Aquatic Chronic 2 |
| GHS Hazard Codes | H319-H351-H411 |
| GHS Hazard Statements | Causes serious eye irritation. Suspected of causing cancer. Toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS08,GHS07,GHS09 |
| GHS Precaution Codes | P273 - P281 - P305 + P351 + P338 |
| GHS Precaution Statements | Avoid release to the environment. Use personal protective equipment as required. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn,N |
| Hazard Symbols Descriptions | Harmful, Dangerous for the environment |
| MDL Number | MFCD00011750 |
| Molecular Formula | C25H3ClN3 |
| Molecular Weight | 407.98 |
| Net Weight | 500 |
| R-Phrases | 40-51/53 |
| S-Phrases | 36/37-61 |
| Tariff Number | 32129000000 |
| Technical Name | CRYSTAL VIOLET |
| Quality Level | 200 |
| Amax | 0.36-0.44 at 589-594 nm |
| concentration | 1% |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| SMILES string | [Cl-].CN(C)c1ccc(cc1)C(c2ccc(cc2)N(C)C)=C3/C=CC(C=C3)=[N+](/C)C |
| InChI key | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
| InChI | 1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1 |
| form | aqueous solution |
Description
Crystal Violet Solution, 1% Aqueous