01904 488599
1,1′-Diethyl-2,2′-Carbocyanine Iodide,
From £50.83 per (ex VAT)
1,1′-Diethyl-2,2′-Carbocyanine Iodide,
| Product Code | 166510-250MG |
|---|---|
| Unit of Measure | 1X250MG |
| CAS Number | 605-91-4 |
| MDL NUMBER | MFCD00011975 |
| EMPIRICAL FORMULA | C25H25IN2 |
| Molecular Weight | 480.38 |
| Synonyms | Pinacyanol Iodide; Quinaldine Blue |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 166510-250MG
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £57.89 |
| 12+ | 20% | £56.48 |
| 36+ | 22% | £55.07 |
| 72+ | 28% | £50.83 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | B |
| CAS Number | 605-91-4 |
| ADR Hazard Labels | 6.1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 60 |
| ADR Packing Group | 2 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| Storage Temperature | 2-8C |
| EINECSNo | 210-099-4 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 3,Acute Tox. 3,Acute Tox. 3 |
| GHS Hazard Codes | H301-H311-H331 |
| GHS Hazard Statements | Toxic if swallowed. Toxic in contact with skin. Toxic if inhaled. |
| GHS Pictograms | GHS06 |
| GHS Precaution Codes | P261 - P280 - P301 + P310 - P311 |
| GHS Signal Words | Danger |
| Hazard Symbols | T |
| Hazard Symbols Descriptions | Toxic |
| MDL Number | MFCD00011975 |
| Melting Point | 295 C (dec.) (lit.) |
| Molecular Formula | C25H25IN2 |
| Molecular Weight | 480.38 |
| Net Weight | 250 |
| Purity Grade | 0.97 |
| R-Phrases | 23/24/25 |
| RTECSNo | VC3676870 |
| S-Phrases | 36/37/39-45 |
| Synonyms | Pinacyanol iodide; Quinaldine blue |
| Tariff Number | 32129000000 |
| GHS Precaution Statements | Avoid breathing dust/ fume/ gas/ mist/ vapours/ spray. Wear protective gloves/ protective clothing. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. Call a POISON CENTER or doctor/ physician. |
| Technical Name | 1,1'-DIETHYL-2,2'-CARBOCYANINE IODIDE |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=166510brand=ALDRICH |
| lambdamax | 614 nm |
| epsilon (extinction coefficient) | >=180000 at 602-608 nm in ethanol |
| Assay | 97% |
| InChI key | QWYZFXLSWMXLDM-UHFFFAOYSA-M |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| Quality Level | 100 |
| SMILES string | [I-].CCN1C(=CC=Cc2ccc3ccccc3[n+]2CC)C=Cc4ccccc14 |
| storage temp. | 2-8C |
| mp | 295 C (dec.) (lit.) |
| InChI | 1S/C25H25N2.HI/c1-3-26-22(18-16-20-10-5-7-14-24(20)26)12-9-13-23-19-17-21-11-6-8-15-25(21)27(23)4-2;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 |
| form | powder |
| solubility | ethanol: 10 mg/mL |
Description
1,1'-Diethyl-2,2'-Carbocyanine Iodide,