01904 488599
Hydroxy Naphthol Blue, Disodium Salt
From £20.95 per (ex VAT)
Hydroxy Naphthol Blue, Disodium Salt
| Product Code | 219916-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 165660-27-5 |
| MDL NUMBER | MFCD00058506 |
| EMPIRICAL FORMULA | C2H12N2Na2O11S3 |
| Molecular Weight | 598.49 |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 219916-5G
| Qty | Discount | Price |
|---|---|---|
| 4+ | 18% | £23.86 |
| 12+ | 20% | £23.28 |
| 36+ | 22% | £22.70 |
| 72+ | 28% | £20.95 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12171500 |
| ADRSuff | 1 |
| CAS Number | 165660-27-5 |
| Storage Temperature | room temp |
| Density | 2.130 g/cm3 |
| GHS Categories | Eye Irrit. 2 |
| GHS Hazard Codes | H319 |
| GHS Hazard Statements | Causes serious eye irritation. |
| GHS Pictograms | GHS07 |
| GHS Precaution Codes | P305 + P351 + P338 |
| GHS Precaution Statements | IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xi |
| Hazard Symbols Descriptions | Irritant |
| MDL Number | MFCD00058506 |
| Melting Point | 274 C |
| Molecular Formula | C2H12N2Na2O11S3 |
| Molecular Weight | 598.49 |
| Net Weight | 5 |
| R-Phrases | 36 |
| S-Phrases | 26-36 |
| Tariff Number | 29270000900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=219916brand=SIAL |
| Quality Level | 200 |
| pH | 7.9 |
| InChI key | WPDDXLRAJOPBIR-UHFFFAOYSA-L |
| storage temp. | room temp |
| Application(s) | diagnostic assay manufacturinghematologyhistology |
| solubility | water: soluble |
| lambdamax | 650 nm |
| grade | ACS reagent |
| mp | 274 C |
| form | solid |
| SMILES string | Oc1cc(c2ccccc2c1N=Nc3c(O)c(cc4cc(ccc34)S(=O)(=O)O[Na])S(=O)(=O)O[Na])S(O)(=O)=O |
| InChI | 1S/C20H14N2O11S3.2Na/c23-15-9-16(35(28,29)30)13-3-1-2-4-14(13)18(15)21-22-19-12-6-5-11(34(25,26)27)7-10(12)8-17(20(19)24)36(31,32)33;;/h1-9,23-24H,(H,25,26,27)(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2 |
Description
Hydroxy Naphthol Blue, Disodium Salt