01904 488599
Poly(Tert-Butyl Acrylate-Co-Ethyl
From £63.40 per (ex VAT)
Poly(Tert-Butyl Acrylate-Co-Ethyl
| Product Code | 444790-250G |
|---|---|
| Unit of Measure | 1X250GR |
| CAS Number | 159666-35-0 |
| MDL NUMBER | MFCD00241441 |
| Synonyms | Ethyl Acrylate-Methacrylic Acid-Tert -Butyl Acrylate Copolymer |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12162002 |
| ADRSuff | 1 |
| CAS Number | 159666-35-0 |
| Density | 0.4 g/mL at 25 C (lit.) |
| Flash Point | Not applicable |
| GHS Categories | NH |
| GHS Hazard Codes | NH |
| GHS Hazard Statements | NH |
| GHS Pictograms | - |
| GHS Precaution Codes | - |
| GHS Remarks | Not a hazardous substance or mixture according to Regulation (EC) No. 1272/2008. |
| GHS Signal Words | - |
| MDL Number | MFCD00241441 |
| Net Weight | 250 |
| Synonyms | Ethyl acrylate-methacrylic acid-tert -butyl acrylate copolymer |
| Tariff Number | 39069090900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=444790brand=ALDRICH |
| SMILES string | CC=CC(O)=O.CCOC(=O)C=C.CC(C)(C)OC(=O)C=C |
| Acid Number | 140-160 mg KOH/g |
| Quality Level | 100 |
| feed ratio | methacrylic acid 23 |
| K-value | 34-40, DIN 53 726 |
| transition temp | Tg 75 C |
| solubility | water and ethanol: soluble in salt form |
| form | powder |
Description
Poly(Tert-Butyl Acrylate-Co-Ethyl