01904 488599
INDOMETHACIN CRYSTALLINE
From £42.60 per (ex VAT)
Indomethacin, 98.5-100.5% (in accordance with BP)
| Product Code | I7378-5G |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 53-86-1 |
| MDL NUMBER | MFCD00057095 |
| EMPIRICAL FORMULA | C19H16ClNO4 |
| Molecular Weight | 357.79 |
| Synonyms | 1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetic acid |
| Brand | SIGMA-ALDRICH |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12161501 |
| ADRSuff | A |
| CAS Number | 53-86-1 |
| ADR Hazard Labels | 6.1 |
| ADR Not Allowed by Post | X |
| ADR Number of Danger | 66 |
| ADR Packing Group | 1 |
| ADR Primary Hazard Class | 6.1 |
| ADR Proper Shipping Name | Toxic solid, organic, n.o.s. |
| ADRNo | 2811 |
| EINECSNo | 200-186-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 3 |
| GHS Hazard Codes | H301 |
| GHS Hazard Statements | Toxic if swallowed. |
| GHS Pictograms | GHS06 |
| GHS Precaution Codes | P301 + P330 + P331 + P310 |
| GHS Precaution Statements | Wash hands thoroughly after handling. IF SWALLOWED: Immediately call a POISON CENTER or doctor/ physician. |
| GHS Signal Words | Danger |
| Hazard Symbols | T+ |
| Hazard Symbols Descriptions | Very toxic |
| MDL Number | MFCD00057095 |
| Melting Point | 158-162 C |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 |
| Net Weight | 5 |
| R-Phrases | 28 |
| RTECSNo | NL3500000 |
| S-Phrases | 28-36/37-45 |
| Synonyms | 1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-3-indoleacetic acid |
| Tariff Number | 29339980900 |
| Technical Name | INDOMETHACIN |
| loss | <=0.5% loss on drying |
| Quality Level | 200 |
| InChI | 1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
| form | powder or crystals |
| biological source | synthetic |
| Mode of action | enzyme | inhibits |
| Assay | 98.5-100.5% (in accordance with EP) |
| mp | 158-162 C |
| Gene Information | human ... ALB(213), ALOX5(240), ELA2(1991), GPR44(11251), IL1A(3552), PLA2G1B(5319), PTGDR(5729), PTGS1(5742), PTGS2(5743)mouse ... Alox5(11689), Ptgdr(19214), Ptger1(19216), Ptger2(19217), Ptger3(19218), Ptger4(19219), Ptgs1(19224)rat ... Alox5(25290), Ptgs1(24693), Ptgs2(29527) |
| SMILES string | COc1ccc2n(c(C)c(CC(O)=O)c2c1)C(=O)c3ccc(Cl)cc3 |
| InChI key | CGIGDMFJXJATDK-UHFFFAOYSA-N |
| originator | Pfizer |
Description
Indomethacin, 98.5-100.5% (in accordance with BP)