01904 488599
Fmoc N-Hydroxysuccinimide Ester, >= 98.
From £57.56 per (ex VAT)
Fmoc N-Hydroxysuccinimide Ester, >= 98.
| Product Code | 46920-5G-F |
|---|---|
| Unit of Measure | 1X5GR |
| CAS Number | 82911-69-1 |
| MDL NUMBER | MFCD00010733 |
| EMPIRICAL FORMULA | C19H15NO5 |
| Molecular Weight | 337.33 |
| Synonyms | 9-Fluorenylmethyl N-Succinimidyl Carbonate; N-(9-Fluorenylmethoxycarbonyloxy)Succinimide; Fmoc-Osu |
| Brand | SIGMA-ALDRICH |
Tiered Pricing - 46920-5G-F
| Qty | Discount | Price |
|---|---|---|
| 4+ | 8% | £64.58 |
| 12+ | 10% | £63.18 |
| 36+ | 12% | £61.78 |
| 72+ | 18% | £57.56 |
Properties
| Property | Value |
|---|---|
| eCl@ss | 32160000 |
| Shipped on ICE | STD |
| UNSPSC Code | 12352000 |
| ADRSuff | 1 |
| CAS Number | 82911-69-1 |
| Storage Temperature | 2-8C |
| EINECSNo | 433-520-5 |
| Flash Point | Not applicable |
| GHS Categories | Acute Tox. 4,Skin Sens. 1,Aquatic Chronic 2 |
| GHS Hazard Codes | H302-H317-H411 |
| GHS Hazard Statements | Harmful if swallowed. May cause an allergic skin reaction. Toxic to aquatic life with long lasting effects. |
| GHS Pictograms | GHS07,GHS09 |
| GHS Precaution Codes | P273 - P280 |
| GHS Precaution Statements | Avoid release to the environment. Wear protective gloves. |
| GHS Signal Words | Warning |
| Hazard Symbols | Xn,N |
| Hazard Symbols Descriptions | Harmful, Dangerous for the environment |
| MDL Number | MFCD00010733 |
| Melting Point | 150-153 C (lit.) |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 |
| Net Weight | 5 |
| R-Phrases | 22-43-51/53 |
| S-Phrases | 24-37-61 |
| Synonyms | 9-Fluorenylmethyl N-succinimidyl carbonate; N-(9-Fluorenylmethoxycarbonyloxy)succinimide; Fmoc-OSu |
| Tariff Number | 29280090900 |
| MSDS Link | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=DElanguage=ENproductNumber=46920brand=ALDRICH |
| Assay | >=98.0% (HPLC) |
| functional group | Fmoc |
| Quality Level | 200 |
| Application(s) | peptide synthesis |
| InChI | 1S/C19H15NO5/c21-17-9-10-18(22)20(17)25-19(23)24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2 |
| storage temp. | 2-8C |
| InChI key | WMSUFWLPZLCIHP-UHFFFAOYSA-N |
| mp | 150-153 C (lit.) |
| SMILES string | O=C(OCC1c2ccccc2-c3ccccc13)ON4C(=O)CCC4=O |
Description
Fmoc N-Hydroxysuccinimide Ester, >= 98.